CAS 1429417-82-2: 4-[(1-Methyl-4-nitro-1H-pyrazol-3-yl)oxy]benzoic acid
Description:4-[(1-Methyl-4-nitro-1H-pyrazol-3-yl)oxy]benzoic acid, identified by its CAS number 1429417-82-2, is a chemical compound characterized by its unique structural features, which include a benzoic acid moiety and a pyrazole ring substituted with a nitro group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups like the carboxylic acid and nitro group. The presence of the pyrazole ring may impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its physical properties and potential applications. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be utilized in various fields, including medicinal chemistry and materials science, depending on its specific properties and reactivity.
Formula:C11H9N3O5
InChI:InChI=1S/C11H9N3O5/c1-13-6-9(14(17)18)10(12-13)19-8-4-2-7(3-5-8)11(15)16/h2-6H,1H3,(H,15,16)
InChI key:InChIKey=OJQONFWSGXETFI-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=C(OC2=NN(C=C2N(=O)=O)C)C=C1
- Synonyms:
- Benzoic acid, 4-[(1-methyl-4-nitro-1H-pyrazol-3-yl)oxy]-
- 4-[(1-Methyl-4-nitro-1H-pyrazol-3-yl)oxy]benzoic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-[(1-Methyl-4-nitro-1H-pyrazol-3-yl)oxy]benzoic acid REF: 3D-EHC41782CAS: 1429417-82-2 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | 4-[(1-methyl-4-nitro-1H-pyrazol-3-yl)oxy]benzoic acid REF: 10-F429155CAS: 1429417-82-2 | - - - | - - - | Discontinued product |

4-[(1-Methyl-4-nitro-1H-pyrazol-3-yl)oxy]benzoic acid
Ref: 3D-EHC41782
50mg | 497.00 € | ||
500mg | 1,357.00 € |

4-[(1-methyl-4-nitro-1H-pyrazol-3-yl)oxy]benzoic acid
Ref: 10-F429155
1g | Discontinued | Request information | |
5g | Discontinued | Request information |