CAS 1429417-82-2: 4-[(1-Methyl-4-nitro-1H-pyrazol-3-yl)oxy]benzoic acid

Description: 4-[(1-Methyl-4-nitro-1H-pyrazol-3-yl)oxy]benzoic acid, identified by its CAS number 1429417-82-2, is a chemical compound characterized by its unique structural features, which include a benzoic acid moiety and a pyrazole ring substituted with a nitro group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups like the carboxylic acid and nitro group. The presence of the pyrazole ring may impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its physical properties and potential applications. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be utilized in various fields, including medicinal chemistry and materials science, depending on its specific properties and reactivity.

Formula: C₁₁H₉N₃O₅

InChI: InChI=1S/C11H9N3O5/c1-13-6-9(14(17)18)10(12-13)19-8-4-2-7(3-5-8)11(15)16/h2-6H,1H3,(H,15,16)

InChI key: InChIKey=OJQONFWSGXETFI-UHFFFAOYSA-N

SMILES: O=C(O)C1=CC=C(OC2=NN(C=C2N(=O)=O)C)C=C1

Synonyms:

• Benzoic acid, 4-[(1-methyl-4-nitro-1H-pyrazol-3-yl)oxy]-
• 4-[(1-Methyl-4-nitro-1H-pyrazol-3-yl)oxy]benzoic acid

4-[(1-Methyl-4-nitro-1H-pyrazol-3-yl)oxy]benzoic acid

CAS: 1429417-82-2

Versatile small molecule scaffold

• Formula: C₁₁H₉N₃O₅
• Purity: Min. 95%
• Molecular weight: 263.21 g/mol

4-[(1-methyl-4-nitro-1H-pyrazol-3-yl)oxy]benzoic acid

CAS: 1429417-82-2

• Molecular weight: 263.2090148925781