CAS 14300-33-5: dicyclopropylmethanol

Description:Dicyclopropylmethanol is an organic compound characterized by its unique structure, which features a central carbon atom bonded to two cyclopropyl groups and a hydroxyl (-OH) functional group. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is relatively insoluble in water but soluble in organic solvents, reflecting its hydrophobic nature due to the presence of the cyclopropyl rings. Dicyclopropylmethanol exhibits interesting chemical properties, including the ability to participate in various reactions typical of alcohols, such as dehydration and oxidation. Its unique structure may also impart specific steric and electronic effects, making it of interest in synthetic organic chemistry and potential applications in pharmaceuticals or agrochemicals. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose risks if ingested or inhaled. Overall, dicyclopropylmethanol is a compound of interest for its distinctive structure and potential utility in various chemical applications.

Formula:C₇H₁₂O

InChI:InChI=1S/C7H12O/c8-7(5-1-2-5)6-3-4-6/h5-8H,1-4H2

InChI key:InChIKey=PIXLZMHERIHLJL-UHFFFAOYSA-N

SMILES:OC(C1CC1)C2CC2

Synonyms:
Cyclopropanemethanol, α-cyclopropyl-
Dicyclopropyl carbinol
Dicyclopropylmethan-1-ol
Dicyclopropylmethyl alcohol
Methanol, dicyclopropyl-
α-Cyclopropylcyclopropanemethanol

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Dicyclopropylmethanol, 97% REF: 02-L01816CAS: 14300-33-5	97%	To inquire	Fri 07 Mar 25
DICYCLOPROPYLMETHANOL REF: IN-DA003PEGCAS: 14300-33-5	95%	To inquire	Thu 13 Mar 25
Dicyclopropylmethanol REF: 10-F622228CAS: 14300-33-5	95%	To inquire	Tue 25 Mar 25
Dicyclopropylmethanol REF: 3D-PAA30033CAS: 14300-33-5	Min. 95%	102.00 €~936.00 €	Mon 24 Mar 25