CAS 1434142-09-2: Methyl 5-bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazole-4-carboxylate
Description:Methyl 5-bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazole-4-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a bromine substituent, and a tetrahydro-pyran moiety. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations. The carboxylate functional group contributes to its acidity and solubility in polar solvents, while the methyl ester enhances its reactivity in nucleophilic substitution reactions. This compound is likely to exhibit biological activity due to its structural features, which may interact with biological targets. Its synthesis typically involves multi-step organic reactions, and it may be utilized in medicinal chemistry for the development of new pharmaceuticals. Additionally, the compound's stability and reactivity can be influenced by the surrounding functional groups and the overall molecular conformation. As with many organic compounds, proper handling and safety precautions are essential due to potential hazards associated with brominated compounds.
Formula:C10H13BrN2O3
InChI:InChI=1S/C10H13BrN2O3/c1-15-10(14)7-6-12-13(9(7)11)8-4-2-3-5-16-8/h6,8H,2-5H2,1H3
InChI key:InChIKey=LPVKDOWUUBOZJX-UHFFFAOYSA-N
SMILES:O=C(OC)C=1C=NN(C1Br)C2OCCCC2
- Synonyms:
- Methyl 5-bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazole-4-carboxylate
- 1H-Pyrazole-4-carboxylic acid, 5-bromo-1-(tetrahydro-2H-pyran-2-yl)-, methyl ester

Methyl 5-bromo-1-tetrahydropyran-2-yl-pyrazole-4-carboxylate
Ref: IN-DA00HWX2
Undefined size | To inquire |

METHYL 5-BROMO-1-(TETRAHYDROPYRAN-2-YL)-1H-PYRAZOLE-4-CARBOXYLATE
Ref: 10-F467521
1g | To inquire | ||
5g | To inquire | ||
250mg | To inquire |

methyl 5-bromo-1-(oxan-2-yl)-1H-pyrazole-4-carboxylate
Ref: 3D-JHC14209
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |