
CAS 1437433-78-7: 6-Chloro-1-(3-methoxypropyl)-1H-benzimidazole-2-carboxaldehyde
Description:6-Chloro-1-(3-methoxypropyl)-1H-benzimidazole-2-carboxaldehyde is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. The presence of a chloro group at the 6-position and a carboxaldehyde functional group at the 2-position contributes to its reactivity and potential applications in organic synthesis. The methoxypropyl substituent at the 1-position enhances its solubility and may influence its biological activity. This compound is typically used in research and development, particularly in medicinal chemistry, due to its potential pharmacological properties. Its structure suggests it may interact with biological targets, making it of interest for further studies in drug discovery. The compound's properties, such as melting point, solubility, and spectral characteristics, would be essential for understanding its behavior in various chemical environments. Safety data and handling precautions should be considered, as with any chemical substance, to ensure safe laboratory practices.
Formula:C12H13ClN2O2
InChI:InChI=1S/C12H13ClN2O2/c1-17-6-2-5-15-11-7-9(13)3-4-10(11)14-12(15)8-16/h3-4,7-8H,2,5-6H2,1H3
InChI key:InChIKey=YQFXZRUJCOHCBI-UHFFFAOYSA-N
SMILES:O=CC1=NC=2C=CC(Cl)=CC2N1CCCOC
- Synonyms:
- 1H-Benzimidazole-2-carboxaldehyde, 6-chloro-1-(3-methoxypropyl)-
- 6-Chloro-1-(3-methoxypropyl)-1H-benzimidazole-2-carboxaldehyde
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 6-Chloro-1-(3-methoxypropyl)-1H-benzo[d]imidazole-2-carbaldehyde REF: 10-F769875CAS: 1437433-78-7 | 98% | - - - | Discontinued product |
![]() | 6-Chloro-1-(3-methoxypropyl)-1H-benzo[D]imidazole-2-carbaldehyde REF: 3D-MHC43378CAS: 1437433-78-7 | Min. 95% | - - - | Discontinued product |

6-Chloro-1-(3-methoxypropyl)-1H-benzo[d]imidazole-2-carbaldehyde
Ref: 10-F769875
1g | Discontinued | Request information | |
500mg | Discontinued | Request information |

6-Chloro-1-(3-methoxypropyl)-1H-benzo[D]imidazole-2-carbaldehyde
Ref: 3D-MHC43378
5g | Discontinued | Request information | |
10g | Discontinued | Request information |