CAS 1437796-65-0: 3H-Indolium, 2-[5-[1-[6-[[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethyl]amino]-6-oxohexyl]-1,3-dihydro-3,3-dimethyl-2H-indol-2-ylidene]-1,3-pentadien-1-yl]-1,3,3-trimethyl-, chloride (1:1)

Description:3H-Indolium, 2-[5-[1-[6-[[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethyl]amino]-6-oxohexyl]-1,3-dihydro-3,3-dimethyl-2H-indol-2-ylidene]-1,3-pentadien-1-yl]-1,3,3-trimethyl-, chloride (1:1) is a complex organic compound characterized by its indolium structure, which features a positively charged nitrogen atom within a fused ring system. This compound exhibits notable biological activity, often investigated for its potential applications in medicinal chemistry and drug development. The presence of multiple functional groups, including amines and carbonyls, suggests it may engage in various chemical interactions, making it a candidate for further research in pharmacology. Its chloride salt form indicates solubility in polar solvents, which is advantageous for biological assays. The intricate molecular architecture may contribute to its reactivity and specificity in biological systems, warranting exploration in therapeutic contexts. Overall, this compound exemplifies the diversity of indole derivatives and their significance in chemical and pharmaceutical research.

Formula:C₃₈H₄₅N₄O₃·Cl

InChI:InChI=1S/C38H44N4O3.ClH/c1-37(2)28-16-11-13-18-30(28)40(5)32(37)20-8-6-9-21-33-38(3,4)29-17-12-14-19-31(29)41(33)26-15-7-10-22-34(43)39-25-27-42-35(44)23-24-36(42)45;/h6,8-9,11-14,16-21,23-24H,7,10,15,22,25-27H2,1-5H3;1H

InChI key:InChIKey=IATQCUIJHBSCGA-UHFFFAOYSA-N

SMILES:[Cl-].O=C1C=CC(=O)N1CCNC(=O)CCCCCN2C=3C=CC=CC3C(C2=CC=CC=CC4=[N+](C=5C=CC=CC5C4(C)C)C)(C)C

Synonyms:
Cy 5 maleimide
Lumiprobe Cy 5 maleimide
3H-Indolium, 2-[5-[1-[6-[[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethyl]amino]-6-oxohexyl]-1,3-dihydro-3,3-dimethyl-2H-indol-2-ylidene]-1,3-pentadien-1-yl]-1,3,3-trimethyl-, chloride (1:1)

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	Cy5 maleimide REF: IN-DA01JSVXCAS: 1437796-65-0	95%	To inquire	Thu 27 Mar 25
	Cy5 maleimide REF: TM-T74120CAS: 1437796-65-0	99.11%	60.00 €~1,012.00 €	Fri 28 Mar 25