
CAS 1439900-13-6: Cyclopentanemethanamine, 3,3-difluoro-, hydrochloride (1:1)
Description:Cyclopentanemethanamine, 3,3-difluoro-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and the presence of difluoromethyl substituents on a cyclopentane ring. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in aqueous solutions. The difluoro substitution suggests that the compound may exhibit unique reactivity and properties compared to its non-fluorinated counterparts, potentially influencing its biological activity and interaction with other molecules. The presence of the hydrochloride indicates that it can donate protons, making it a weak base. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could affect its pharmacokinetics and pharmacodynamics. Additionally, the specific arrangement of atoms and functional groups may lead to interesting applications in various fields, including materials science and organic synthesis. However, detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C6H11F2N·ClH
InChI:InChI=1S/C6H11F2N.ClH/c7-6(8)2-1-5(3-6)4-9;/h5H,1-4,9H2;1H
InChI key:InChIKey=HWMZUTJOBXFEKK-UHFFFAOYSA-N
SMILES:Cl.FC1(F)CCC(CN)C1
- Synonyms:
- Cyclopentanemethanamine, 3,3-difluoro-, hydrochloride (1:1)

(3,3-DIFLUOROCYCLOPENTYL)METHANAMINE OXALATE
Ref: IN-DA019EUL
1g | To inquire | ||
2g | To inquire | ||
5g | To inquire | ||
100mg | 558.00 € | ||
250mg | To inquire |

(3,3-DIFLUOROCYCLOPENTYL)METHANAMINE HCL
Ref: 10-F387839
1g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire | ||
500mg | To inquire |

(3,3-difluorocyclopentyl)methanamine hcl
Ref: 3D-PHC90013
1g | 828.00 € | ||
100mg | 391.00 € |