CAS 1439902-82-5: 3-Amino-1-(tetrahydro-2H-pyran-4-yl)-2(1H)-pyridinone

Description: 3-Amino-1-(tetrahydro-2H-pyran-4-yl)-2(1H)-pyridinone is a chemical compound characterized by its unique structural features, which include a pyridinone core and a tetrahydro-pyran moiety. This compound typically exhibits properties associated with both amines and heterocycles, such as potential basicity due to the amino group and the ability to participate in hydrogen bonding. The presence of the tetrahydro-pyran ring contributes to its cyclic structure, which can influence its solubility and reactivity. The compound may display biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular interactions can be influenced by the functional groups present, which may affect its pharmacokinetic properties. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-Amino-1-(tetrahydro-2H-pyran-4-yl)-2(1H)-pyridinone represents a versatile structure with potential applications in various chemical and biological contexts.

Formula: C₁₀H₁₄N₂O₂

InChI: InChI=1S/C10H14N2O2/c11-9-2-1-5-12(10(9)13)8-3-6-14-7-4-8/h1-2,5,8H,3-4,6-7,11H2

InChI key: InChIKey=HZFSTMTUCZQZGA-UHFFFAOYSA-N

SMILES: O=C1C(N)=CC=CN1C2CCOCC2

Synonyms:

• 3-Amino-1-(oxan-4-yl)-1,2-dihydropyridin-2-one
• 3-Amino-1-(oxan-4-yl)pyridin-2-one
• 3-Amino-1-(tetrahydro-2H-pyran-4-yl)-2(1H)-pyridinone
• 2(1H)-Pyridinone, 3-amino-1-(tetrahydro-2H-pyran-4-yl)-

3-Amino-1-(oxan-4-yl)-1,2-dihydropyridin-2-one

CAS: 1439902-82-5

Versatile small molecule scaffold

• Formula: C₁₀H₁₄N₂O₂
• Purity: Min. 95%
• Molecular weight: 194.23 g/mol

3-Amino-1-(oxan-4-yl)-1,2-dihydropyridin-2-one

CAS: 1439902-82-5

• Molecular weight: 194.23399353027344