CAS 1439902-82-5: 3-Amino-1-(tetrahydro-2H-pyran-4-yl)-2(1H)-pyridinone
Description:3-Amino-1-(tetrahydro-2H-pyran-4-yl)-2(1H)-pyridinone is a chemical compound characterized by its unique structural features, which include a pyridinone core and a tetrahydro-pyran moiety. This compound typically exhibits properties associated with both amines and heterocycles, such as potential basicity due to the amino group and the ability to participate in hydrogen bonding. The presence of the tetrahydro-pyran ring contributes to its cyclic structure, which can influence its solubility and reactivity. The compound may display biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular interactions can be influenced by the functional groups present, which may affect its pharmacokinetic properties. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-Amino-1-(tetrahydro-2H-pyran-4-yl)-2(1H)-pyridinone represents a versatile structure with potential applications in various chemical and biological contexts.
Formula:C10H14N2O2
InChI:InChI=1S/C10H14N2O2/c11-9-2-1-5-12(10(9)13)8-3-6-14-7-4-8/h1-2,5,8H,3-4,6-7,11H2
InChI key:InChIKey=HZFSTMTUCZQZGA-UHFFFAOYSA-N
SMILES:O=C1C(N)=CC=CN1C2CCOCC2
- Synonyms:
- 3-Amino-1-(oxan-4-yl)-1,2-dihydropyridin-2-one
- 3-Amino-1-(oxan-4-yl)pyridin-2-one
- 3-Amino-1-(tetrahydro-2H-pyran-4-yl)-2(1H)-pyridinone
- 2(1H)-Pyridinone, 3-amino-1-(tetrahydro-2H-pyran-4-yl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-Amino-1-(oxan-4-yl)-1,2-dihydropyridin-2-one REF: 3D-PHC90282CAS: 1439902-82-5 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | 3-Amino-1-(oxan-4-yl)-1,2-dihydropyridin-2-one REF: 10-F097002CAS: 1439902-82-5 | - - - | - - - | Discontinued product |

3-Amino-1-(oxan-4-yl)-1,2-dihydropyridin-2-one
Ref: 3D-PHC90282
50mg | 870.00 € | ||
500mg | 2,597.00 € |

Ref: 10-F097002
1g | Discontinued | Request information |