CAS 1443291-27-7: 1-[1-[(2,4-Dichlorophenyl)methyl]-1H-1,2,3-triazol-4-yl]ethanone
Description:1-[1-[(2,4-Dichlorophenyl)methyl]-1H-1,2,3-triazol-4-yl]ethanone, with the CAS number 1443291-27-7, is a chemical compound characterized by its triazole ring structure, which is known for its diverse biological activities. The presence of the 2,4-dichlorophenyl group contributes to its lipophilicity and potential interactions with biological targets. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many triazole derivatives. Its structure suggests potential applications in pharmaceuticals, particularly as an antifungal or antimicrobial agent, due to the triazole moiety's known efficacy in these areas. Additionally, the compound may possess unique reactivity patterns owing to the ketone functional group, which can participate in various chemical reactions. Overall, the characteristics of this compound make it a subject of interest in medicinal chemistry and drug development, although specific biological activity and toxicity profiles would require further investigation through empirical studies.
Formula:C11H9Cl2N3O
InChI:InChI=1S/C11H9Cl2N3O/c1-7(17)11-6-16(15-14-11)5-8-2-3-9(12)4-10(8)13/h2-4,6H,5H2,1H3
InChI key:InChIKey=HIIOHIKACGGSTH-UHFFFAOYSA-N
SMILES:O=C(C=1N=NN(C1)CC2=CC=C(Cl)C=C2Cl)C
- Synonyms:
- 1-[1-[(2,4-Dichlorophenyl)methyl]-1H-1,2,3-triazol-4-yl]ethanone
- Ethanone, 1-[1-[(2,4-dichlorophenyl)methyl]-1H-1,2,3-triazol-4-yl]-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-{1-[(2,4-Dichlorophenyl)methyl]-1H-1,2,3-triazol-4-yl}ethan-1-one REF: 54-OR303293CAS: 1443291-27-7 | - - - | 213.00 €~270.00 € | Thu 03 Apr 25 |
![]() | 1-(1-(2,4-Dichlorobenzyl)-1H-1,2,3-triazol-4-yl)ethan-1-one REF: 10-F769942CAS: 1443291-27-7 | 98% | - - - | Discontinued product |
![]() | 1-{1-[(2,4-Dichlorophenyl)methyl]-1H-1,2,3-triazol-4-yl}ethan-1-one REF: 3D-THC29127CAS: 1443291-27-7 | Min. 95% | - - - | Discontinued product |

1-{1-[(2,4-Dichlorophenyl)methyl]-1H-1,2,3-triazol-4-yl}ethan-1-one
Ref: 54-OR303293
1g | 270.00 € | ||
500mg | 213.00 € |

1-(1-(2,4-Dichlorobenzyl)-1H-1,2,3-triazol-4-yl)ethan-1-one
Ref: 10-F769942
1g | Discontinued | Request information | |
500mg | Discontinued | Request information |

1-{1-[(2,4-Dichlorophenyl)methyl]-1H-1,2,3-triazol-4-yl}ethan-1-one
Ref: 3D-THC29127
1g | Discontinued | Request information | |
5g | Discontinued | Request information |