CAS 1443305-53-0: α-(3,5-Dichlorophenyl)-5-methyl-2-furanmethanol

Description:α-(3,5-Dichlorophenyl)-5-methyl-2-furanmethanol is a chemical compound characterized by its unique structure, which includes a furan ring and a dichlorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the furan ring suggests that it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic additions. The dichlorophenyl moiety can influence the compound's reactivity and stability, as well as its interaction with biological systems. Additionally, the methyl group contributes to the steric and electronic properties of the molecule. While specific physical properties like melting point, boiling point, and solubility may vary, compounds of this nature often demonstrate moderate to high lipophilicity, which can affect their bioavailability and pharmacokinetics. Overall, α-(3,5-Dichlorophenyl)-5-methyl-2-furanmethanol is of interest in fields such as medicinal chemistry and materials science due to its potential applications.

Formula:C₁₂H₁₀Cl₂O₂

InChI:InChI=1S/C12H10Cl2O2/c1-7-2-3-11(16-7)12(15)8-4-9(13)6-10(14)5-8/h2-6,12,15H,1H3

InChI key:InChIKey=XSBIVMNQGQRXTN-UHFFFAOYSA-N

SMILES:ClC=1C=C(Cl)C=C(C1)C(O)C=2OC(=CC2)C

Synonyms:
α-(3,5-Dichlorophenyl)-5-methyl-2-furanmethanol
2-Furanmethanol, α-(3,5-dichlorophenyl)-5-methyl-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	3,5-Dichlorophenyl-(5-methyl-2-furyl)methanol REF: 10-F395176CAS: 1443305-53-0	97.0%	- - -	Discontinued product
	3,5-Dichlorophenyl-(5-methyl-2-furyl)methanol REF: 3D-THC30553CAS: 1443305-53-0	Min. 95%	- - -	Discontinued product