CAS 1443350-15-9: 3-Fluoro-5-(3-methylbutoxy)benzoic acid

Description:3-Fluoro-5-(3-methylbutoxy)benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a fluorine atom and a 3-methylbutoxy group. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its reactivity and biological activity. The 3-methylbutoxy group contributes to the compound's hydrophobic characteristics, potentially affecting its solubility in various solvents. As a benzoic acid derivative, it possesses a carboxylic acid functional group, which can participate in hydrogen bonding and may influence its acidity and reactivity in chemical reactions. This compound may be of interest in pharmaceutical research and development due to its unique structural features, which could impart specific biological activities or interactions. Its CAS number, 1443350-15-9, allows for precise identification in chemical databases and literature. Overall, the combination of functional groups and substituents in 3-Fluoro-5-(3-methylbutoxy)benzoic acid suggests potential applications in various fields, including medicinal chemistry and materials science.

Formula:C₁₂H₁₅FO₃

InChI:InChI=1S/C12H15FO3/c1-8(2)3-4-16-11-6-9(12(14)15)5-10(13)7-11/h5-8H,3-4H2,1-2H3,(H,14,15)

InChI key:InChIKey=OOMKSSBLPRWPKV-UHFFFAOYSA-N

SMILES:O=C(O)C=1C=C(F)C=C(OCCC(C)C)C1

Synonyms:
Benzoic acid, 3-fluoro-5-(3-methylbutoxy)-
3-Fluoro-5-(3-methylbutoxy)benzoic acid

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	5-Fluoro-3-iso-pentoxybenzoic acid REF: 10-F398379CAS: 1443350-15-9	97.0%	- - -	Discontinued product
	3-Fluoro-5-(isopentyloxy)benzoic acid REF: 3D-THC35015CAS: 1443350-15-9	Min. 95%	- - -	Discontinued product