CAS 1447913-56-5: 5-(Trifluoromethyl)-3-thiophenemethanol
Description:5-(Trifluoromethyl)-3-thiophenemethanol is an organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The compound features a trifluoromethyl group (-CF3) attached to the thiophene, which significantly influences its chemical properties, including increased lipophilicity and potential reactivity. The hydroxymethyl group (-CH2OH) at the 3-position of the thiophene ring contributes to its functionality, making it a potential candidate for various chemical reactions, such as nucleophilic substitutions or as a building block in organic synthesis. The trifluoromethyl group can enhance the compound's stability and alter its electronic properties, making it of interest in medicinal chemistry and materials science. Additionally, the presence of fluorine atoms often imparts unique characteristics, such as increased metabolic stability in biological systems. Overall, this compound's unique structural features make it a subject of interest for further research in various chemical applications.
Formula:C6H5F3OS
InChI:InChI=1S/C6H5F3OS/c7-6(8,9)5-1-4(2-10)3-11-5/h1,3,10H,2H2
InChI key:InChIKey=JHPPIFOSKSRKDK-UHFFFAOYSA-N
SMILES:FC(F)(F)C=1SC=C(C1)CO
- Synonyms:
- [5-(Trifluoromethyl)-3-thienyl]methanol
- 3-Thiophenemethanol, 5-(trifluoromethyl)-
- 5-(Trifluoromethyl)-3-thiophenemethanol
- [5-(Trifluoromethyl)thiophen-3-yl]methanol

(5-Trifluoromethyl-Thiophen-3-Yl)-Methanol
Ref: IN-DA00HX7V
100mg | 534.00 € | ||
250mg | To inquire | ||
500mg | To inquire |

(5-TRIFLUOROMETHYL-THIOPHEN-3-YL)-METHANOL
Ref: 10-F470255
100mg | To inquire | ||
250mg | To inquire | ||
500mg | To inquire |

(5-Trifluoromethyl-thiophen-3-yl)-methanol
Ref: 3D-XHC91356
1g | 1,318.00 € | ||
50mg | 233.00 € | ||
100mg | 348.00 € | ||
250mg | 586.00 € | ||
500mg | 894.00 € |