CAS 1449-55-4: tetracyclohexylstannane
Description:Tetracyclohexylstannane, with the CAS number 1449-55-4, is an organotin compound characterized by the presence of a tin atom bonded to four cyclohexyl groups. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It exhibits low solubility in water but is soluble in organic solvents, making it useful in various chemical applications. Tetracyclohexylstannane is known for its stability and resistance to hydrolysis, which is a common trait among organotin compounds. It is often utilized as a reagent in organic synthesis and as a stabilizer in polymer formulations. However, like many organotin compounds, it may pose environmental and health risks, leading to regulatory scrutiny. Proper handling and disposal are essential to mitigate potential toxicity. Overall, tetracyclohexylstannane is a significant compound in organometallic chemistry, with applications that leverage its unique chemical properties.
Formula:C24H44Sn
InChI:InChI=1S/4C6H11.Sn/c4*1-2-4-6-5-3-1;/h4*1H,2-6H2;
InChI key:InChIKey=JUISPCSEIXBMNI-UHFFFAOYSA-N
SMILES:C1CCC(CC1)[Sn](C2CCCCC2)(C3CCCCC3)C4CCCCC4
- Synonyms:
- Stannane, tetracyclohexyl-
- Tetracyclohexyltin
- Tetrakis(cyclohexyl)tin
- Tin, tetracyclohexyl-
- Tetracyclohexylstannane
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Tetracyclohexyltin, 99% REF: 08-50-1800CAS: 1449-55-4 | 99% | 59.00 €~222.00 € | Mon 24 Mar 25 |
![]() | Stannane, tetracyclohexyl- REF: IN-DA001KBICAS: 1449-55-4 | 98% | 47.00 €~192.00 € | Thu 27 Mar 25 |
![]() | TETRACYCLOHEXYLTIN REF: 3H-SNT7262CAS: 1449-55-4 | - - - | - - - | Discontinued product |
![]() | Stannane, tetracyclohexyl- REF: 3D-BAA44955CAS: 1449-55-4 | Min. 95% | - - - | Discontinued product |

Tetracyclohexyltin, 99%
Ref: 08-50-1800
1g | 59.00 € | ||
5g | 222.00 € |

Stannane, tetracyclohexyl-
Ref: IN-DA001KBI
1g | 94.00 € | ||
5g | 192.00 € | ||
250mg | 47.00 € |

Ref: 3H-SNT7262
5g | Discontinued | Request information |

Stannane, tetracyclohexyl-
Ref: 3D-BAA44955
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information |