CAS 1450-93-7: 1H-Imidazol-2-amine, sulfate (2:1)
Description:1H-Imidazol-2-amine, sulfate (2:1), with the CAS number 1450-93-7, is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance typically appears as a white to off-white solid and is soluble in water due to the presence of the sulfate group, which enhances its solubility. The compound is often used in biochemical and pharmaceutical applications, particularly as a building block in the synthesis of various bioactive molecules. Its imidazole moiety is known for participating in hydrogen bonding and coordination chemistry, making it relevant in enzyme catalysis and as a ligand in coordination complexes. Additionally, the sulfate component contributes to its ionic nature, which can influence its reactivity and interaction with biological systems. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C3H5N3H2O4S
InChI:InChI=1S/C3H5N3.H2O4S/c4-3-5-1-2-6-3;1-5(2,3)4/h1-2H,(H3,4,5,6);(H2,1,2,3,4)
InChI key:InChIKey=LEUJVEZIEALICS-UHFFFAOYSA-N
SMILES:O=S(=O)(O)O.N=1C=CNC1N
- Synonyms:
- 1H-Imidazol-2-amine, sulfate (2:1)
- 1H-imidazol-2-amine sulfurate
- 2-Aminoimidazole hemisulfate
- 2-Aminoimidazole sulfate (2:1)
- 2-Aminoimidazolium sulfate
- Imidazole, 2-amino-, sulfate (2:1)
