CAS 145416-96-2: [(2R)-3,5-dibenzoyloxytetrahydrofuran-2-yl]methyl benzoate
Description:The chemical substance known as [(2R)-3,5-dibenzoyloxytetrahydrofuran-2-yl]methyl benzoate, with the CAS number 145416-96-2, is a complex organic compound characterized by its tetrahydrofuran ring structure, which is substituted with two benzoyloxy groups and a benzoate moiety. This compound exhibits properties typical of esters, including potential solubility in organic solvents and a tendency to undergo hydrolysis in the presence of water or under acidic/basic conditions. The presence of multiple aromatic rings contributes to its stability and may influence its reactivity and interaction with biological systems. Additionally, the stereochemistry indicated by the (2R) configuration suggests specific spatial arrangements that can affect the compound's biological activity and pharmacokinetics. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in drug development and as intermediates in organic synthesis. Overall, the characteristics of this substance make it a subject of interest for further research in various chemical and pharmaceutical fields.
Formula:C26H22O7
InChI:InChI=1/C26H22O7/c27-24(18-10-4-1-5-11-18)30-17-22-21(32-25(28)19-12-6-2-7-13-19)16-23(31-22)33-26(29)20-14-8-3-9-15-20/h1-15,21-23H,16-17H2/t21?,22-,23?/m1/s1

D-erythro-Pentofuranose, 2-deoxy-, 1,3,5-tribenzoate
Ref: IN-DA001D0J
Undefined size | To inquire |

1,3,5-Tri-O-benzoyl-2-deoxyribofuranose
Controlled ProductRef: TR-T767660
100mg | 155.00 € | ||
250mg | 211.00 € | ||
500mg | 380.00 € |

1,3,5-Tri-O-benzoyl-2-deoxyribofuranose
Ref: 3D-MT28570
1g | 774.00 € | ||
2g | 1,307.00 € | ||
250mg | 333.00 € | ||
500mg | 497.00 € |