CAS 14581-21-6: Hydrazine, (4-chlorophenyl)-, sulfate (2:1)

Description:Hydrazine, (4-chlorophenyl)-, sulfate (2:1), with the CAS number 14581-21-6, is a chemical compound that features a hydrazine moiety substituted with a 4-chlorophenyl group and exists in a sulfate salt form. This compound typically appears as a crystalline solid and is characterized by its potential use in various chemical applications, including as a reagent in organic synthesis and in the production of pharmaceuticals. The presence of the 4-chlorophenyl group may impart specific reactivity and solubility properties, influencing its behavior in chemical reactions. Hydrazine derivatives are known for their reducing properties, and the sulfate form can enhance stability and solubility in aqueous environments. However, hydrazine and its derivatives are also associated with toxicity and potential environmental hazards, necessitating careful handling and disposal. Overall, this compound is of interest in both industrial and research settings, particularly in the fields of organic chemistry and materials science.

Formula:C₆H₇ClN₂H₂O₄S

InChI:InChI=1S/C6H7ClN2.H2O4S/c7-5-1-3-6(9-8)4-2-5;1-5(2,3)4/h1-4,9H,8H2;(H2,1,2,3,4)

InChI key:InChIKey=VAGJQUQWYHFUOX-UHFFFAOYSA-N

SMILES:O=S(=O)(O)O.ClC1=CC=C(C=C1)NN

Synonyms:
(4-Chlorophenyl)Hydrazine Sulfate (2:1)
4-Chlorophenylhydrazine sulfate
Hydrazine, (4-chlorophenyl)-, sulfate (2:1)
Hydrazine, (p-chlorophenyl)-, sulfate (2:1)

Found 3 products.

Product data	Purity	Price range	Estimated delivery
4-Chlorophenylhydrazine Sulfate REF: 3B-C0258CAS: 14581-21-6	>95.0%(T)	57.00 €~456.00 €	Thu 20 Mar 25
Hydrazine, (4-chlorophenyl)-, sulfate (2:1) REF: IN-DA001DG9CAS: 14581-21-6	95%	65.00 €~571.00 €	Thu 27 Mar 25
4-Chlorophenylhydrazine Sulfate REF: 3D-PAA58121CAS: 14581-21-6	Min. 95%	- - -	Discontinued product