CAS 146087-19-6: Hydroxysafflor yellow A

Description:Hydroxysafflor yellow A is a natural pigment derived from the flower of Carthamus tinctorius, commonly known as safflower. It is characterized by its bright yellow color, which is attributed to its flavonoid structure. This compound is soluble in water and organic solvents, making it versatile for various applications, including food coloring and traditional medicine. Hydroxysafflor yellow A exhibits antioxidant properties, which may contribute to its potential health benefits, such as anti-inflammatory and neuroprotective effects. Its safety profile has been evaluated, and it is generally recognized as safe for consumption within established limits. The compound's chemical structure includes hydroxyl groups that enhance its reactivity and solubility. Additionally, it is often studied for its potential therapeutic applications in treating conditions like cardiovascular diseases and certain types of cancer. Overall, Hydroxysafflor yellow A is notable for its vibrant color, natural origin, and promising biological activities, making it a subject of interest in both food science and pharmacology.

Formula:C₂₇H₃₂O₁₆

InChI:InChI=1S/C27H32O16/c28-7-12-16(32)19(35)21(37)23(42-12)15-18(34)14(11(31)6-3-9-1-4-10(30)5-2-9)24(39)27(41,25(15)40)26-22(38)20(36)17(33)13(8-29)43-26/h1-6,12-13,16-17,19-23,26,28-30,32-33,35-41H,7-8H2/b6-3+/t12-,13-,16-,17-,19+,20+,21-,22-,23+,26-,27?/m1/s1

InChI key:InChIKey=LIPJRCGLQNIXGO-ONZBGLOFSA-N

SMILES:O=C(C=CC1=CC=C(O)C=C1)C=2C(=O)C(=C(O)C(O)(C2O)C3OC(CO)C(O)C(O)C3O)C4OC(CO)C(O)C(O)C4O

Synonyms:
(6E)-2,5-dihydroxy-6-[(E)-1-hydroxy-3-(4-hydroxyphenyl)prop-2-enylidene]-2,4-bis[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]cyclohex-4-ene-1,3-dione
2,4-Di-β-D-glucopyranosyl-3,4,5-trihydroxy-6-[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]-2,5-cyclohexadien-1-one
2,5-Cyclohexadien-1-one, 2,4-di-β-D-glucopyranosyl-3,4,5-trihydroxy-6-[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]-
2,5-Cyclohexadien-1-one, 2,4-di-β-D-glucopyranosyl-3,4,5-trihydroxy-6-[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propenyl]-
2,5-Cyclohexadien-1-one, 2,4-di-β-D-
Safflomin A
glucopyranosyl-3,4,5-trihydroxy-6-[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]-
hydroxy safflor yellow A
2,4-Di-β-D-glucopyranosyl-3,4,5-trihydroxy-6-[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]-2,5-cyclohexadien-1-one
2,5-Cyclohexadien-1-one, 2,4-di-β-D-glucopyranosyl-3,4,5-trihydroxy-6-[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]-
See more synonyms
2,5-Cyclohexadien-1-one, 2,4-di-β-D-glucopyranosyl-3,4,5-trihydroxy-6-[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propenyl]-
Hydroxysafflor yellow A