CAS 146137-88-4: 4-METHOXY-BENZO[B]THIOPHENE-2-CARBOXYLIC ACID METHYL ESTER
Description:4-Methoxy-benzo[b]thiophene-2-carboxylic acid methyl ester, with the CAS number 146137-88-4, is an organic compound characterized by its unique structure that combines a methoxy group, a benzo[b]thiophene ring, and a carboxylic acid methyl ester functionality. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential reactivity due to the presence of the carboxylic acid moiety. The methoxy group can influence its solubility and polarity, making it more soluble in organic solvents. Additionally, the presence of the thiophene ring may impart interesting electronic properties, which can be beneficial in applications such as organic electronics or as intermediates in synthetic chemistry. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Overall, its structural features suggest potential utility in various chemical applications, including materials science and medicinal chemistry.
Formula:C11H10O3S
InChI:InChI=1S/C11H10O3S/c1-13-8-4-3-5-9-7(8)6-10(15-9)11(12)14-2/h3-6H,1-2H3
InChI key:InChIKey=BGXBEXAXVSOWJC-UHFFFAOYSA-N
SMILES:O=C(OC)C=1SC=2C=CC=C(OC)C2C1
- Synonyms:
- 4-Methoxybenzo[b]thiophene-2-carboxylic acid methyl ester
- Benzo[b]thiophene-2-carboxylic acid, 4-methoxy-, methyl ester
- Methyl 4-Methoxy-1-Benzothiophene-2-Carboxylate
- Methyl 4-methoxybenzo[b]thiophene-2-carboxylate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Benzo[b]thiophene-2-carboxylic acid, 4-methoxy-, methyl ester REF: IN-DA001DPVCAS: 146137-88-4 | - - - | To inquire | Wed 26 Mar 25 |
![]() | Methyl 4-methoxybenzo[b]thiophene-2-carboxylate REF: 10-F638437CAS: 146137-88-4 | 95+% | - - - | Discontinued product |
![]() | 4-Methoxy-benzo[b]thiophene-2-carboxylic acid methyl ester REF: 3D-WFA13788CAS: 146137-88-4 | Min. 95% | - - - | Discontinued product |

Benzo[b]thiophene-2-carboxylic acid, 4-methoxy-, methyl ester
Ref: IN-DA001DPV
Undefined size | To inquire |

Methyl 4-methoxybenzo[b]thiophene-2-carboxylate
- Ethers
- Esters
- 5-membered Heterocycles
- Benzothiophenes
- See more categories
- Esters and Derivatives
Ref: 10-F638437
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |

4-Methoxy-benzo[b]thiophene-2-carboxylic acid methyl ester
Ref: 3D-WFA13788
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |