CAS 1461726-87-3: 1,1-Dimethylethyl hexahydro-2-[(hydroxyamino)iminomethyl]-1H-azepine-1-carboxylate

Description:1,1-Dimethylethyl hexahydro-2-[(hydroxyamino)iminomethyl]-1H-azepine-1-carboxylate, identified by its CAS number 1461726-87-3, is a chemical compound characterized by its complex structure, which includes a hexahydroazepine ring and functional groups such as a carboxylate and a hydroxyamino group. This compound is likely to exhibit properties typical of amines and carboxylic acids, including potential basicity and reactivity towards electrophiles. The presence of the dimethyl group suggests steric hindrance, which may influence its reactivity and interactions with other molecules. Additionally, the hydroxyamino group can participate in hydrogen bonding, potentially affecting solubility and stability in various solvents. The azepine ring structure may also contribute to unique conformational properties, influencing its biological activity and potential applications in pharmaceuticals or agrochemicals. Overall, the compound's characteristics are defined by its functional groups and ring structure, which dictate its chemical behavior and potential uses in various fields.

Formula:C₁₂H₂₃N₃O₃

InChI:InChI=1S/C12H23N3O3/c1-12(2,3)18-11(16)15-8-6-4-5-7-9(15)10(13)14-17/h9,17H,4-8H2,1-3H3,(H2,13,14)

InChI key:InChIKey=PZWYWRIGGCOSGS-UHFFFAOYSA-N

SMILES:O=C(OC(C)(C)C)N1CCCCCC1C(=N)NO

Synonyms:
1,1-Dimethylethyl hexahydro-2-[(hydroxyamino)iminomethyl]-1H-azepine-1-carboxylate
1H-Azepine-1-carboxylic acid, hexahydro-2-[(hydroxyamino)iminomethyl]-, 1,1-dimethylethyl ester

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	tert-butyl 2-(N'-hydroxycarbamimidoyl)azepane-1-carboxylate REF: 10-F769939CAS: 1461726-87-3	98%	- - -	Discontinued product
	tert-Butyl 2-(N'-hydroxycarbamimidoyl)azepane-1-carboxylate REF: 3D-LIC72687CAS: 1461726-87-3	Min. 95%	- - -	Discontinued product