CAS 1467-86-3: 6-Methylbenzo[b]thiophene-2-carboxylic acid

Description:6-Methylbenzo[b]thiophene-2-carboxylic acid is an organic compound characterized by its unique structure, which includes a benzo[b]thiophene ring system substituted with a methyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and the ability to participate in electrophilic substitution reactions. The presence of the carboxylic acid group contributes to its acidity and potential for forming hydrogen bonds, influencing its solubility in polar solvents. Additionally, the methyl substitution can affect the compound's reactivity and steric hindrance. This substance may be of interest in various fields, including organic synthesis and materials science, due to its potential applications in the development of pharmaceuticals or as a building block in organic chemistry. Its CAS number, 1467-86-3, allows for easy identification in chemical databases and literature. Overall, 6-Methylbenzo[b]thiophene-2-carboxylic acid is a versatile compound with distinct chemical properties that can be leveraged in various chemical applications.

Formula:C₁₀H₈O₂S

InChI:InChI=1/C10H8O2S/c1-6-2-3-7-5-9(10(11)12)13-8(7)4-6/h2-5H,1H3,(H,11,12)

Synonyms:
Benzo[b]thiophene-2-carboxylic acid, 6-methyl-
T56 Bsj Cvq H1
6-Methyl-1-Benzothiophene-2-Carboxylic Acid
6-Methylbenzo[b]thiophene-2-carboxylic acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Benzo[b]thiophene-2-carboxylic acid, 6-methyl- REF: IN-DA001E99CAS: 1467-86-3	97%	To inquire	Thu 27 Mar 25
6-Methylbenzo[b]thiophene-2-carboxylic acid REF: 54-OR3103CAS: 1467-86-3	99%	32.00 €~411.00 €	Fri 28 Mar 25
6-Methylbenzo[b]thiophene-2-carboxylic acid REF: 10-F325637CAS: 1467-86-3	95.0%	20.00 €~1,475.00 €	Tue 01 Apr 25
6-Methylbenzo[b]thiophene-2-carboxylic acid REF: 3D-BAA46786CAS: 1467-86-3	Min. 95%	To inquire	Thu 08 May 25