CAS 147-82-0: 2,4,6-Tribromoaniline
Description:2,4,6-Tribromoaniline is an organic compound characterized by the presence of three bromine atoms and an amino group attached to a benzene ring. Its molecular formula is C6H3Br3N, indicating a structure that includes a phenyl group substituted with bromine at the 2, 4, and 6 positions relative to the amino group. This compound typically appears as a solid, often with a crystalline or powdery texture, and is known for its relatively low solubility in water but higher solubility in organic solvents. 2,4,6-Tribromoaniline is primarily used in the synthesis of various dyes and pigments, as well as in research applications involving brominated compounds. It is important to note that, like many brominated compounds, it may pose environmental and health risks, necessitating careful handling and disposal. The compound's properties, such as melting point and boiling point, can vary based on purity and specific conditions, but it is generally recognized for its stability under standard conditions.
Formula:C6H4Br3N
InChI:InChI=1S/C6H4Br3N/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2
InChI key:InChIKey=GVPODVKBTHCGFU-UHFFFAOYSA-N
SMILES:BrC=1C=C(Br)C(N)=C(Br)C1
- Synonyms:
- 2,4,6-Tribromo-phenylamine
- 2,4,6-Tribromobenzenamine
- Aniline, 2,4,6-tribromo-
- Benzenamine, 2,4,6-tribromo-
- NSC 2216
- Tribromoanisole
- sym-Tribromoaniline
- 2,4,6-Tribromoaniline
