CAS 147702-14-5: (S)-VANOL
Description:(S)-VANOL, with the CAS number 147702-14-5, is a chiral alcohol that is primarily recognized for its role in organic synthesis and as a chiral auxiliary in asymmetric synthesis. This compound features a specific stereochemistry, which is crucial for its reactivity and interaction with other molecules, particularly in enantioselective reactions. (S)-VANOL is characterized by its ability to form hydrogen bonds, which enhances its solubility in polar solvents and contributes to its utility in various chemical reactions. It is often employed in the synthesis of pharmaceuticals and agrochemicals, where chirality is essential for biological activity. The compound's physical properties, such as boiling point and melting point, are influenced by its molecular structure and functional groups. Additionally, (S)-VANOL can participate in various chemical transformations, including oxidation and esterification, making it a versatile building block in synthetic organic chemistry. Its applications extend to the development of new materials and catalysts, showcasing its importance in both academic research and industrial processes.
Formula:C32H22O2
InChI:InChI=1/C32H22O2/c33-31-25-17-9-7-15-23(25)19-27(21-11-3-1-4-12-21)29(31)30-28(22-13-5-2-6-14-22)20-24-16-8-10-18-26(24)32(30)34/h1-20,33-34H
- Synonyms:
- (R)-Vanol
- (S)-3,3'-Diphenyl-2,2'-Bi(1-Naphthalol)
- (R)-3,3'-Diphenyl-2,2'-Bi-1-Naphthalol
- (2S)-(-)-3,3'-Diphenyl-[2,2'-Binaphthalene]-1,1'-Diol
- (2R)-(+)-3,3'-Diphenyl-[2,2'-Binaphthalene]-1,1'-Diol
- (2R)-(+)-3,3'-Diphenyl-[2,2'-binaphthalene]-1,1'-diol,min.98%(R)-VANOL
- (2R)-(+)-3,3'-Diphenyl-[2,2'-Binaphthalene]-1,1'-Diol (R)-Vanol
- 3,3'-Diphenyl-2,2'-Binaphthalene-1,1'-Diol

[2,2'-Binaphthalene]-1,1'-diol, 3,3'-diphenyl-, (2S)-
Ref: IN-DA001F4H
1g | 515.00 € | ||
5g | To inquire | ||
50mg | 49.00 € | ||
100mg | 73.00 € | ||
250mg | 140.00 € |

(2S)-3,3'-Diphenyl[2,2'-binaphthalene]-1,1'-diol
Ref: 10-F547859
1g | 596.00 € |

(2S)-(-)-3,3'-Diphenyl-[2,2'-binaphthalene]-1,1'-diol, min. 98% (S)-VANOL
Ref: 08-08-1702
100mg | 334.00 € | ||
500mg | 1,285.00 € |

(S)-VANOL
Ref: 3D-FV178072
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |