CAS 148043-73-6: 4,4,5,5,5-Pentafluoro-1-pentanol
Description:4,4,5,5,5-Pentafluoro-1-pentanol is a fluorinated alcohol characterized by the presence of five fluorine atoms attached to the carbon backbone, specifically at the 4th and 5th positions of a pentanol chain. This compound features a hydroxyl (-OH) functional group, which imparts alcohol-like properties, including the ability to engage in hydrogen bonding. The presence of multiple fluorine atoms significantly influences its physical and chemical properties, such as increased hydrophobicity and thermal stability, while also enhancing its volatility. It is typically a colorless liquid at room temperature and exhibits low solubility in water due to the strong electronegativity of fluorine, which affects the overall polarity of the molecule. 4,4,5,5,5-Pentafluoro-1-pentanol is of interest in various applications, including as a solvent or reagent in organic synthesis, and may also have potential uses in the development of fluorinated materials. Safety precautions should be observed when handling this compound, as fluorinated substances can pose unique health and environmental risks.
Formula:C5H7F5O
InChI:InChI=1S/C5H7F5O/c6-4(7,2-1-3-11)5(8,9)10/h11H,1-3H2
InChI key:InChIKey=QROUUECTKRZFHF-UHFFFAOYSA-N
SMILES:FC(F)(F)C(F)(F)CCCO
- Synonyms:
- 1-Pentanol, 4,4,5,5,5-pentafluoro-
- 2-methyl-5-(trifluoromethyl)-2,4-dihydro-3H-pyrazol-3-one
- 4,4,5,5,5-Pentafluoro-1-pentanol
- 4,4,5,5,5-Pentafluoropentan-1-ol
- 4,4,5,5,5-Pentafluoropentanol
