CAS 14986-21-1: Hexachlorodisiloxane
Description:Hexachlorodisiloxane, with the CAS number 14986-21-1, is an organosilicon compound characterized by its unique structure, which consists of silicon and oxygen atoms, along with six chlorine atoms. This compound typically appears as a colorless to pale yellow liquid and is known for its high density and viscosity. Hexachlorodisiloxane is notable for its chemical stability and resistance to thermal degradation, making it useful in various industrial applications, particularly in the synthesis of silicone polymers and as an intermediate in chemical processes. Its chlorinated nature imparts specific properties, such as increased hydrophobicity and potential antimicrobial activity. However, due to the presence of chlorine, it may pose environmental and health risks, necessitating careful handling and disposal. Additionally, hexachlorodisiloxane's reactivity can lead to the formation of other silicon-based compounds, which can be exploited in material science and chemical manufacturing. Overall, its unique characteristics make it a compound of interest in both research and industrial applications.
Formula:Cl6OSi2
InChI:InChI=1S/Cl6OSi2/c1-8(2,3)7-9(4,5)6
InChI key:InChIKey=QHAHOIWVGZZELU-UHFFFAOYSA-N
SMILES:Cl[Si](Cl)(Cl)O[Si](Cl)(Cl)Cl
- Synonyms:
- 1,1,1,3,3,3-Hexachlorodisiloxane
- Bis(trichlorosilyl) ether
- Bis(trichlorosilyl) oxide
- Disiloxane, 1,1,1,3,3,3-hexachloro-
- Disiloxane, hexachloro-
- Perchlorodisiloxane
- Silicon chloride oxide (Si<sub>2</sub>OCl<sub>6</sub>)
- Silicon oxychloride (Si<sub>2</sub>OCl<sub>6</sub>)
- Trichloro(trichlorosiloxo)silane
- Silicon chloride oxide (Si2OCl6)
- See more synonyms
- Hexachlorodisiloxane
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Disiloxane, 1,1,1,3,3,3-hexachloro- REF: IN-DA001M2SCAS: 14986-21-1 | - - - | 148.00 €~484.00 € | Thu 27 Mar 25 |
 | Hexachlorodisiloxane REF: 10-S09350CAS: 14986-21-1 | - - - | To inquire | Tue 08 Apr 25 |
 | HEXACHLORODISILOXANE, 90% REF: 3H-SIH5910.0CAS: 14986-21-1 | 90% | - - - | Discontinued product |
 | Hexachlorodisiloxane REF: 3D-FH59829CAS: 14986-21-1 | Min. 95% | - - - | Discontinued product |
Disiloxane, 1,1,1,3,3,3-hexachloro-
Ref: IN-DA001M2S
| 1g | 148.00 € | ||
| 5g | 484.00 € |
HEXACHLORODISILOXANE, 90%
Ref: 3H-SIH5910.0
| 10g | Discontinued | Request information |
Hexachlorodisiloxane
Ref: 3D-FH59829
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
