CAS 1501-05-9: δ-Oxobenzenepentanoic acid
Description:δ-Oxobenzenepentanoic acid, also known by its CAS number 1501-05-9, is an organic compound characterized by its structure, which features a benzene ring substituted with a pentanoic acid chain and a keto group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, including moderate solubility in organic solvents and limited solubility in water due to its hydrophobic benzene ring. The presence of the carboxylic acid functional group imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the keto group can engage in tautomeric shifts and contribute to the compound's reactivity. δ-Oxobenzenepentanoic acid may also exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its synthesis often involves multi-step organic reactions, and it can serve as an intermediate in the production of more complex molecules. Overall, this compound is notable for its unique structural features and potential applications in various fields of chemistry.
Formula:C11H12O3
InChI:InChI=1S/C11H12O3/c12-10(7-4-8-11(13)14)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,13,14)
InChI key:InChIKey=SHKWSBAVRQZYLE-UHFFFAOYSA-N
SMILES:O=C(O)CCCC(=O)C=1C=CC=CC1
- Synonyms:
- 1501-05-9
- 4-Benzoylbutanoic acid
- 4-Benzoylbutyric acid
- 5-Oxo-5-phenylpentanoic acid
- 5-Oxo-5-phenylvaleric acid
- 5-Phenyl-5-oxopentanoic acid
- 5-Phenyl-5-oxovaleric acid
- Benzenepentanoic acid, delta-oxo-
- Benzenepentanoic acid, δ-oxo-
- Butyric acid, 4-benzoyl-
- See more synonyms
- NSC 10139
- γ-Benzoylbutyric acid
- δ-Oxobenzenepentanoic acid
