CAS 1505-62-0: 5-Methylbenzo[b]thiophene-2-carboxylic acid
Description:5-Methylbenzo[b]thiophene-2-carboxylic acid is an organic compound characterized by its unique structure, which includes a benzo[b]thiophene ring system substituted with a methyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions due to the presence of the carboxylic acid group. The methyl substitution can influence its solubility and reactivity, making it of interest in organic synthesis and medicinal chemistry. Additionally, the presence of the thiophene ring may impart specific electronic properties, enhancing its potential applications in materials science and as a building block in the synthesis of more complex molecules. The compound is likely to be a solid at room temperature, with potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H8O2S
InChI:InChI=1S/C10H8O2S/c1-6-2-3-8-7(4-6)5-9(13-8)10(11)12/h2-5H,1H3,(H,11,12)
InChI key:InChIKey=OUFWTHMQVXSBCF-UHFFFAOYSA-N
SMILES:O=C(O)C=1SC=2C=CC(=CC2C1)C
- Synonyms:
- 2-Carboxy-5-methylbenzo[b]thiophene
- 5-Methyl-2-benzothiophenecarboxylic acid
- 5-Methylbenzo[b]thiophene-2-carboxylic acid
- Akos B018461
- Art-Chem-Bb B018461
- Benzo[b]thiophene-2-carboxylic acid, 5-methyl-

Benzo[b]thiophene-2-carboxylic acid, 5-methyl-
Ref: IN-DA001MOJ
1g | 485.00 € | ||
5g | To inquire | ||
10g | To inquire | ||
100mg | 144.00 € | ||
250mg | 172.00 € | ||
500mg | 245.00 € |

Ref: 54-OR183516
Undefined size | To inquire |

5-Methylbenzo[b]thiophene-2-carboxylic acid
Ref: 10-F239705
1g | To inquire | ||
5g | To inquire |

5-Methylbenzo[b]thiophene-2-carboxylic acid
Ref: 3D-BAA50562
1g | 388.00 € | ||
10g | 2,024.00 € |