CAS 1505-62-0: 5-Methylbenzo[b]thiophene-2-carboxylic acid

Description:5-Methylbenzo[b]thiophene-2-carboxylic acid is an organic compound characterized by its unique structure, which includes a benzo[b]thiophene ring system substituted with a methyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions due to the presence of the carboxylic acid group. The methyl substitution can influence its solubility and reactivity, making it of interest in organic synthesis and medicinal chemistry. Additionally, the presence of the thiophene ring may impart specific electronic properties, enhancing its potential applications in materials science and as a building block in the synthesis of more complex molecules. The compound is likely to be a solid at room temperature, with potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula:C₁₀H₈O₂S

InChI:InChI=1S/C10H8O2S/c1-6-2-3-8-7(4-6)5-9(13-8)10(11)12/h2-5H,1H3,(H,11,12)

InChI key:InChIKey=OUFWTHMQVXSBCF-UHFFFAOYSA-N

SMILES:O=C(O)C=1SC=2C=CC(=CC2C1)C

Synonyms:
2-Carboxy-5-methylbenzo[b]thiophene
5-Methyl-2-benzothiophenecarboxylic acid
5-Methylbenzo[b]thiophene-2-carboxylic acid
Akos B018461
Art-Chem-Bb B018461
Benzo[b]thiophene-2-carboxylic acid, 5-methyl-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Benzo[b]thiophene-2-carboxylic acid, 5-methyl- REF: IN-DA001MOJCAS: 1505-62-0	97%	To inquire	Tue 11 Mar 25
5-Methylbenzo[b]thiophene-2-carboxylic acid REF: 54-OR183516CAS: 1505-62-0	95%	To inquire	Wed 12 Mar 25
5-Methylbenzo[b]thiophene-2-carboxylic acid REF: 10-F239705CAS: 1505-62-0	95.0%	To inquire	Fri 21 Mar 25
5-Methylbenzo[b]thiophene-2-carboxylic acid REF: 3D-BAA50562CAS: 1505-62-0	Min. 95%	To inquire	Tue 22 Apr 25