CAS 150668-38-5: cyclopropyl-(3,5-dimethylphenyl)methanone

Description: Cyclopropyl-(3,5-dimethylphenyl)methanone, with the CAS number 150668-38-5, is an organic compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring known for its strain and reactivity, attached to a phenyl ring that is further substituted with two methyl groups at the 3 and 5 positions. This substitution pattern can influence the compound's physical and chemical properties, such as its solubility, boiling point, and reactivity. The presence of the carbonyl group (ketone) in the methanone structure contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions. The compound may exhibit interesting biological activities due to its structural characteristics, making it of interest in medicinal chemistry and drug development. Overall, cyclopropyl-(3,5-dimethylphenyl)methanone is a compound that combines the unique properties of its functional groups and ring structure, leading to diverse applications in organic synthesis and potential pharmacological research.

Formula: C₁₂H₁₄O

InChI: InChI=1/C12H14O/c1-8-5-9(2)7-11(6-8)12(13)10-3-4-10/h5-7,10H,3-4H2,1-2H3

Cyclopropyl 3,5-dimethylphenyl ketone

CAS: 150668-38-5

• Purity: 97.0%
• Molecular weight: 174.2429962158203

Cyclopropyl 3,5-dimethylphenyl ketone

CAS: 150668-38-5

Versatile small molecule scaffold

• Formula: C₁₂H₁₄O
• Purity: Min. 95%
• Molecular weight: 174.24 g/mol