CAS 151389-25-2: 2-(piperidin-4-yl)pyrimidine

Description: 2-(Piperidin-4-yl)pyrimidine is a chemical compound characterized by its pyrimidine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms at positions 1 and 3. The compound features a piperidine moiety, a saturated six-membered ring containing one nitrogen atom, attached at the 2-position of the pyrimidine. This structural arrangement contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of both nitrogen-containing rings can influence the compound's solubility, polarity, and ability to interact with biological targets. Typically, compounds like 2-(piperidin-4-yl)pyrimidine may exhibit properties such as moderate to high lipophilicity, which can affect their pharmacokinetics. Additionally, the compound may serve as a scaffold for the development of pharmaceuticals, particularly in the fields of neuropharmacology and oncology, due to its ability to modulate various biological pathways. Its synthesis and characterization are essential for understanding its reactivity and potential applications in drug discovery.

Formula: C₉H₁₃N₃

InChI: InChI=1/C9H13N3/c1-4-11-9(12-5-1)8-2-6-10-7-3-8/h1,4-5,8,10H,2-3,6-7H2

Synonyms:

• Pyrimidine, 2-(4-Piperidinyl)-
• 2-(Piperidin-4-yl)pyrimidine

2-(Piperidin-4-yl)pyrimidine

CAS: 151389-25-2

• Formula: C₉H₁₃N₃
• Molecular weight: 163.2196

2-(Piperidin-4-yl)pyrimidine

CAS: 151389-25-2

• Purity: 98%
• Molecular weight: 163.2239990234375

2-piperidin-4-ylpyrimidine

CAS: 151389-25-2

Versatile small molecule scaffold

• Formula: C₉H₁₃N₃
• Purity: Min. 95%
• Molecular weight: 163.22 g/mol