CAS 151729-42-9: 2-Amino-4-(trifluoromethyl)-5-thiazolecarbonitrile
Description:2-Amino-4-(trifluoromethyl)-5-thiazolecarbonitrile is a heterocyclic compound characterized by the presence of both thiazole and nitrile functional groups. The thiazole ring contributes to its aromatic properties, while the amino group enhances its reactivity, making it a potential candidate for various chemical reactions. The trifluoromethyl group is notable for its electron-withdrawing properties, which can significantly influence the compound's reactivity and stability. This substance is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its unique structure allows it to participate in diverse chemical transformations, making it of interest in pharmaceutical and agrochemical research. Additionally, the presence of the nitrile group suggests potential applications in synthesis and as a building block for more complex molecules. Safety data should be consulted for handling, as compounds with trifluoromethyl groups can exhibit specific toxicological profiles. Overall, 2-Amino-4-(trifluoromethyl)-5-thiazolecarbonitrile is a versatile compound with potential applications in various fields of chemistry.
Formula:C5H2F3N3S
InChI:InChI=1S/C5H2F3N3S/c6-5(7,8)3-2(1-9)12-4(10)11-3/h(H2,10,11)
InChI key:InChIKey=APPKJRRASVSBHQ-UHFFFAOYSA-N
SMILES:N#CC=1SC(=NC1C(F)(F)F)N
- Synonyms:
- 5-Thiazolecarbonitrile, 2-amino-4-(trifluoromethyl)-
- 2-Amino-4-(trifluoromethyl)-5-thiazolecarbonitrile
- 2-Amino-4-(trifluoromethyl)thiazole-5-carbonitrile
- 2-Amino-5-cyano-4-trifluoromethylthiazole
- 2-Amino-4-(trifluoromethyl)-1,3-thiazole-5-carbonitrile
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Amino-5-cyano-4-trifluoromethylthiazole REF: 3D-FA101869CAS: 151729-42-9 | Min. 95% | - - - | Discontinued product |

2-Amino-5-cyano-4-trifluoromethylthiazole
Ref: 3D-FA101869
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |