CAS 151793-25-8: N1-Cyclopropyl-N1-(1-methylethyl)-1,2-ethanediamine
Description:N1-Cyclopropyl-N1-(1-methylethyl)-1,2-ethanediamine, identified by its CAS number 151793-25-8, is an organic compound characterized by its unique structure, which includes a cyclopropyl group and an isopropyl substituent attached to a 1,2-ethanediamine backbone. This compound features two amine functional groups, which contribute to its potential as a ligand in coordination chemistry and its reactivity in various organic synthesis reactions. The presence of the cyclopropyl ring introduces strain, which can influence the compound's reactivity and stability. Additionally, the branched isopropyl group may enhance steric hindrance, affecting its interactions with other molecules. N1-Cyclopropyl-N1-(1-methylethyl)-1,2-ethanediamine may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its solubility and stability in different solvents can vary, impacting its applications in research and industry. Overall, this compound's unique structural features make it a valuable candidate for further study in various chemical contexts.
Formula:C8H18N2
InChI:InChI=1S/C8H18N2/c1-7(2)10(6-5-9)8-3-4-8/h7-8H,3-6,9H2,1-2H3
InChI key:InChIKey=OHVBKCDWGYTWFH-UHFFFAOYSA-N
SMILES:NCCN(C(C)C)C1CC1
- Synonyms:
- N1-Cyclopropyl-N1-(1-methylethyl)-1,2-ethanediamine
- 1,2-Ethanediamine, N-cyclopropyl-N-(1-methylethyl)-
- 1,2-Ethanediamine, N1-cyclopropyl-N1-(1-methylethyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | N-(2-Aminoethyl)-N-(propan-2-yl)cyclopropanamine REF: 3D-BGA79325CAS: 151793-25-8 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | n-(2-Aminoethyl)-N-(propan-2-yl)cyclopropanamine REF: 10-F670026CAS: 151793-25-8 | 95% | - - - | Discontinued product |

N-(2-Aminoethyl)-N-(propan-2-yl)cyclopropanamine
Ref: 3D-BGA79325
50mg | 496.00 € | ||
500mg | 1,249.00 € |

n-(2-Aminoethyl)-N-(propan-2-yl)cyclopropanamine
Ref: 10-F670026
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |