CAS 15182-67-9: 1,2-Dihydro-1-(2-methoxyphenyl)-5H-tetrazole-5-thione
Description:1,2-Dihydro-1-(2-methoxyphenyl)-5H-tetrazole-5-thione, with the CAS number 15182-67-9, is a chemical compound characterized by its tetrazole ring structure, which is a five-membered heterocyclic compound containing four nitrogen atoms and one carbon atom. This compound features a methoxyphenyl group, contributing to its aromatic properties and potential for various chemical interactions. The presence of a thione functional group (R-SH) indicates that it may exhibit properties typical of thiols, such as reactivity with electrophiles and potential for forming metal complexes. The compound's structure suggests it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with tetrazole derivatives. Additionally, its solubility and stability in various solvents can influence its reactivity and potential uses in synthesis or as a reagent in organic chemistry. Overall, this compound represents a unique combination of functional groups that may lend itself to diverse applications in chemical research and industry.
Formula:C8H8N4OS
InChI:InChI=1S/C8H8N4OS/c1-13-7-5-3-2-4-6(7)12-8(14)9-10-11-12/h2-5H,1H3,(H,9,11,14)
InChI key:InChIKey=JCCAUOFIVYLQMS-UHFFFAOYSA-N
SMILES:S=C1NN=NN1C=2C=CC=CC2OC
- Synonyms:
- 1,2-Dihydro-1-(2-methoxyphenyl)-5H-tetrazole-5-thione
- 1-(2-Methoxyphenyl)-1H-1,2,3,4-tetrazole-5-thiol
- 1-(2-Methoxyphenyl)tetrazole-5-thiol
- 1-(2-methoxyphenyl)-1,2-dihydro-5H-tetrazole-5-thione
- 1-(o-Methoxyphenyl)-1H-tetrazole-5-thiol
- 1-(o-Methoxyphenyl)-2-tetrazoline-5-thione
- 1-(o-Methoxyphenyl)-5-thioxo-2-tetrazoline
- 2-Tetrazoline-5-thione, 1-(o-methoxyphenyl)-
- 5H-Tetrazole-5-thione, 1,2-dihydro-1-(2-methoxyphenyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-(2-methoxyphenyl)-4,5-dihydro-1H-1,2,3,4-tetrazole-5-thione REF: 10-F643614CAS: 15182-67-9 | 95% | - - - | Discontinued product |
![]() | 1-(2-Methoxyphenyl)-1H-1,2,3,4-tetrazole-5-thiol REF: 3D-QAA18267CAS: 15182-67-9 | Min. 95% | - - - | Discontinued product |

1-(2-methoxyphenyl)-4,5-dihydro-1H-1,2,3,4-tetrazole-5-thione
Ref: 10-F643614
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

1-(2-Methoxyphenyl)-1H-1,2,3,4-tetrazole-5-thiol
Ref: 3D-QAA18267
1g | Discontinued | Request information | |
100mg | Discontinued | Request information |