CAS 15182-68-0: 1-(4-ETHOXYPHENYL)-5-MERCAPTO-1H-TETRAZOLE
Description:1-(4-Ethoxyphenyl)-5-mercapto-1H-tetrazole, with the CAS number 15182-68-0, is a chemical compound that belongs to the class of tetrazoles, which are five-membered heterocyclic compounds containing four nitrogen atoms and one carbon atom. This particular compound features an ethoxy group and a mercapto group, contributing to its unique chemical properties. It is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which is common for many organic compounds with hydrophobic substituents. The presence of the mercapto group (-SH) suggests potential reactivity, particularly in nucleophilic substitution reactions or as a reducing agent. Additionally, the ethoxyphenyl moiety may impart certain electronic properties, influencing the compound's reactivity and interaction with other chemical species. This compound may find applications in various fields, including pharmaceuticals, agrochemicals, and materials science, due to its potential biological activity and functional properties. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C9H10N4OS
InChI:InChI=1/C9H10N4OS/c1-2-14-8-5-3-7(4-6-8)13-9(15)10-11-12-13/h3-6H,2H2,1H3,(H,10,12,15)
- Synonyms:
- 1-(4-ethoxyphenyl)-1,2-dihydro-5H-Tetrazole-5-thione
- 1-(4-Ethoxyphenyl)-1H-Tetrazole-5-Thiol
- Akos Bbs-00000556
- 4-(5-Mercaptotetrazolo)Phenetole
- 4-Ethoxy Pmt
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1-(4-Ethoxyphenyl)-5-mercapto-1H-tetrazole REF: 3B-E0668CAS: 15182-68-0 | >98.0%(HPLC) | 108.00 € | Thu 20 Mar 25 |
 | 1-(4-Ethoxyphenyl)-1H-tetrazole-5-thiol REF: IN-DA003CZ7CAS: 15182-68-0 | 98% | 55.00 € | Thu 27 Mar 25 |
 | 1-(4-ethoxyphenyl)-4,5-dihydro-1H-1,2,3,4-tetrazole-5-thione REF: 10-F723531CAS: 15182-68-0 | 98% | To inquire | Tue 08 Apr 25 |
 | 1-(4-Ethoxyphenyl)-5-mercapto-1H-tetrazole REF: 3D-FE75821CAS: 15182-68-0 | Min. 95% | - - - | Discontinued product |
1-(4-Ethoxyphenyl)-5-mercapto-1H-tetrazole
Ref: 3B-E0668
| 5g | 108.00 € |
1-(4-Ethoxyphenyl)-1H-tetrazole-5-thiol
Ref: IN-DA003CZ7
| 1g | 55.00 € |
1-(4-ethoxyphenyl)-4,5-dihydro-1H-1,2,3,4-tetrazole-5-thione
Ref: 10-F723531
| 1g | To inquire |
1-(4-Ethoxyphenyl)-5-mercapto-1H-tetrazole
Ref: 3D-FE75821
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 50g | Discontinued | Request information | |
| 100g | Discontinued | Request information | |
| 250g | Discontinued | Request information |
