CAS 151870-74-5: Kinsenoside
Description:Kinsenoside is a natural compound classified as a glycoside, primarily derived from the plant species *Ophiopogon japonicus*. It is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and neuroprotective effects. Kinsenoside exhibits a unique chemical structure characterized by a sugar moiety linked to a phenolic aglycone, which contributes to its biological activity. The compound has garnered interest in the field of traditional medicine and modern pharmacology due to its ability to modulate various signaling pathways, potentially offering therapeutic benefits in conditions such as neurodegenerative diseases and metabolic disorders. Additionally, kinsenoside is being studied for its effects on cellular processes, including apoptosis and oxidative stress response. Its safety profile and efficacy are subjects of ongoing research, making it a compound of interest in both natural product chemistry and drug development. As with many bioactive compounds, further studies are necessary to fully elucidate its mechanisms of action and potential clinical applications.
Formula:C10H16O8
InChI:InChI=1S/C10H16O8/c11-2-5-7(13)8(14)9(15)10(18-5)17-4-1-6(12)16-3-4/h4-5,7-11,13-15H,1-3H2/t4-,5-,7-,8+,9-,10-/m1/s1
InChI key:InChIKey=MQEPWBMWFIVRPS-ZGSHZZHUSA-N
SMILES:O=C1OCC(OC2OC(CO)C(O)C(O)C2O)C1
- Synonyms:
- (+)-Kinsenoside
- (4R)-4-(β-<span class="text-smallcaps">D</span>-Glucopyranosyloxy)dihydro-2(3H)-furanone
- 2(3H)-Furanone, 4-(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)dihydro-, (4R)-
- 2(3H)-Furanone, 4-(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)dihydro-, (R)-
- 2(3H)-Furanone,4-(b-D-glucopyranosyloxy)dihydro-,(R)-
- 2(3H)-Furanone, 4-(β-D-glucopyranosyloxy)dihydro-, (4R)-
- (4R)-4-(β-D-Glucopyranosyloxy)dihydro-2(3H)-furanone
