CAS 152460-08-7: (2-Methyl-5-nitrophenyl)guanidine nitrate
Description:(2-Methyl-5-nitrophenyl)guanidine nitrate, with the CAS number 152460-08-7, is a chemical compound that features a guanidine functional group attached to a substituted phenyl ring. This compound typically exhibits characteristics associated with both the guanidine and nitrophenyl moieties, including potential basicity due to the guanidine group and the presence of a nitro group, which can influence its reactivity and stability. The nitro group often imparts explosive properties, making such compounds of interest in the field of energetic materials. Additionally, the methyl substitution on the phenyl ring can affect the compound's solubility and interaction with other substances. In terms of safety, compounds containing nitro groups can be sensitive to heat and shock, necessitating careful handling and storage. Overall, (2-Methyl-5-nitrophenyl)guanidine nitrate is a specialized compound with applications in research and potentially in the development of new materials, particularly in the context of explosives or propellants.
Formula:C8H10N4O2·HNO3
InChI:InChI=1S/C8H10N4O2.HNO3/c1-5-2-3-6(12(13)14)4-7(5)11-8(9)10;2-1(3)4/h2-4H,1H3,(H4,9,10,11);(H,2,3,4)
InChI key:InChIKey=IINMQQJNRFDBMV-UHFFFAOYSA-N
SMILES:O=N(=O)O.O=N(=O)C1=CC=C(C(=C1)NC(=N)N)C
- Synonyms:
- 1-(2-Methyl-5-nitrophenyl)guanidine nitrate
- 2-(2-Methyl-5-Nitrophenyl)Guanidine Nitrate (1:1)
- Guanidine, (2-methyl-5-nitrophenyl)-, mononitrate
- Guanidine, N-(2-methyl-5-nitrophenyl)-, nitrate (1:1)
- N-(2-Methyl-5-nitrophenyl)guanidine nitrate
- (2-Methyl-5-nitrophenyl)guanidine nitrate
