CAS 15265-26-6: PHENOLPHTHALEIN GLUCURONIC ACID
Description:Phenolphthalein glucuronic acid, with the CAS number 15265-26-6, is a chemical compound that combines the properties of phenolphthalein, a well-known pH indicator, with glucuronic acid, a sugar acid derived from glucose. This compound typically exhibits characteristics associated with both components: it may display colorimetric changes in response to pH variations, similar to phenolphthalein, which transitions from colorless to pink in alkaline conditions. The glucuronic acid moiety contributes to the compound's solubility and potential biological activity, as glucuronic acid is involved in detoxification processes in the body. The presence of the glucuronic acid structure may enhance the compound's interactions with biological systems, making it of interest in pharmacology and biochemistry. Additionally, phenolphthalein glucuronic acid may be utilized in various analytical applications, particularly in studies involving pH measurement and biochemical assays. Overall, this compound represents a unique intersection of organic chemistry and biochemistry, with potential implications in both research and practical applications.
Formula:C26H21NaO10
InChI:InChI=1/C26H22O10.Na/c27-15-9-5-13(6-10-15)26(18-4-2-1-3-17(18)24(33)36-26)14-7-11-16(12-8-14)34-25-21(30)19(28)20(29)22(35-25)23(31)32;/h1-12,19-22,25,27-30H,(H,31,32);/q;+1/p-1/t19-,20-,21+,22-,25+,26?;/m0./s1
- Synonyms:
- Phenolphthaleinglucuronide
- Phenolphthalein Mono-Beta-D-Glucosiduronic Acid
- Phenolphthalein Mono-Beta-Glucosiduronic Acid
- Phenolphthalein Mono-Beta-Glucuronic Acid
- Phenolphthalein-Beta-D-Glca
- Phenolphthalein-Beta-D-Glucuronic Acid
- Phenolphthalein-Beta-D-Glucuronide
- 4-[1-(4-hydroxyphenyl)-3-oxo-1,3-dihydro-2-benzofuran-1-yl]phenyl beta-D-glucopyranosiduronic acid
- sodium (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-{4-[1-(4-hydroxyphenyl)-3-oxo-1,3-dihydro-2-benzofuran-1-yl]phenoxy}tetrahydro-2H-pyran-2-carboxylate (non-preferred name)