CAS 15308-34-6: Benzenemethanol, α-(aminomethyl)-3-hydroxy-, hydrochloride (1:1)

Description:Benzenemethanol, α-(aminomethyl)-3-hydroxy-, hydrochloride (1:1), commonly known as a hydrochloride salt, is a chemical compound characterized by its structural features that include a benzene ring, a hydroxyl group, and an amino group. This compound typically exhibits properties associated with both alcohols and amines, such as solubility in water due to the presence of the hydroxyl group, while the amino group can participate in hydrogen bonding. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which often enhances its stability and solubility in aqueous solutions. This substance may be utilized in various applications, including pharmaceuticals, where it can serve as an intermediate or active ingredient. Its specific biological activity, toxicity, and reactivity would depend on the context of its use and the presence of other functional groups in related compounds. As with many chemical substances, proper handling and safety measures should be observed due to potential health risks associated with exposure.

Formula:C₈H₁₁NO₂·ClH

InChI:InChI=1S/C8H11NO2.ClH/c9-5-8(11)6-2-1-3-7(10)4-6;/h1-4,8,10-11H,5,9H2;1H

InChI key:InChIKey=OWMFSWZUAWKDRR-UHFFFAOYSA-N

SMILES:Cl.OC1=CC=CC(=C1)C(O)CN