Product correctly added to cart.

Benzoic acid, 5-(4-morpholinyl)-2-nitro-

CAS 153437-51-5: Benzoic acid, 5-(4-morpholinyl)-2-nitro-

Description:Benzoic acid, 5-(4-morpholinyl)-2-nitro- is an organic compound characterized by its benzoic acid backbone, which features a nitro group and a morpholine substituent. The presence of the nitro group at the 2-position and the morpholine ring at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its aromatic structure. The morpholine moiety enhances its potential for biological activity, making it of interest in pharmaceutical research. Benzoic acid derivatives often exhibit antimicrobial and antifungal properties, and the specific substitution pattern can influence their reactivity and interaction with biological targets. Additionally, the compound may participate in various chemical reactions, such as esterification or amidation, due to the carboxylic acid functional group. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, this compound exemplifies the diverse chemistry of substituted benzoic acids and their potential applications in various fields.

Formula:C11H12N2O5

InChI:InChI=1S/C11H12N2O5/c14-11(15)9-7-8(1-2-10(9)13(16)17)12-3-5-18-6-4-12/h1-2,7H,3-6H2,(H,14,15)

InChI key:InChIKey=YLZSNFZNVCUXMM-UHFFFAOYSA-N

SMILES:O=C(O)C1=CC(=CC=C1N(=O)=O)N2CCOCC2

Sort by


See more categories

This search does not contain any category.

Found 2 products.

discount label

5-(Morpholin-4-yl)-2-nitrobenzoic acid

CAS:153437-51-5

Discontinued product
Welcome to CymitQuimica!We use cookies to enhance your visit. We do not include advertising.

Please see our Cookies Policy for more details or adjust your preferences in "Settings".