CAS 154229-20-6: Pyridine, 3-androsta-3,5,16-trien-17-yl-
Description:Pyridine, 3-androsta-3,5,16-trien-17-yl- (CAS 154229-20-6) is a chemical compound that features a pyridine ring fused with a steroid structure. This compound is characterized by its unique combination of a nitrogen-containing heterocyclic ring and a steroid backbone, which contributes to its potential biological activity. Pyridine itself is known for its aromatic properties and is often used as a solvent or in the synthesis of various organic compounds. The presence of the steroid moiety suggests that this compound may exhibit hormonal or bioactive properties, potentially influencing biological pathways. Its structural complexity may also impact its solubility, stability, and reactivity, making it of interest in medicinal chemistry and pharmacology. Additionally, the specific arrangement of functional groups and stereochemistry can significantly affect its interactions with biological targets, which is crucial for its application in drug development or as a biochemical probe. Overall, this compound represents a fascinating intersection of heterocyclic chemistry and steroid biochemistry.
Formula:C24H29N
InChI:InChI=1S/C24H29N/c1-23-13-4-3-7-18(23)8-9-19-21-11-10-20(17-6-5-15-25-16-17)24(21,2)14-12-22(19)23/h3,5-8,10,15-16,19,21-22H,4,9,11-14H2,1-2H3/t19-,21-,22-,23-,24+/m0/s1
InChI key:InChIKey=LAZGFPQCCUTDPH-NHFPKVKZSA-N
SMILES:N=1C=CC=C(C1)C2=CCC3C4CC=C5C=CCCC5(C)C4CCC23C

Anhydro Abiraterone (3-((8R,9S,10R,13S,14S)-10,13-dimethyl-2,7,8,9,10,11,12,13,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)pyridine; 17-(Pyridin-3-yl)androsta-3,5,16-triene)
Ref: 45-1A03430
25mg | 3,823.00 € |

Anhydro Abiraterone
Ref: 4Z-A-8220
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

Anhydro Abiraterone
Ref: TR-A637910
1mg | 308.00 € | ||
5mg | 1,333.00 € | ||
10mg | 2,046.00 € |

Anhydro abiraterone
Controlled ProductRef: 3D-EGA22920
25mg | 909.00 € | ||
50mg | 1,301.00 € | ||
100mg | 1,905.00 € | ||
250mg | 3,334.00 € |