CAS 15451-33-9: 4-but-3-en-1-ylbenzonitrile

Description: 4-but-3-en-1-ylbenzonitrile, also known by its CAS number 15451-33-9, is an organic compound characterized by the presence of both a nitrile group and an alkenyl side chain attached to a benzene ring. The structure features a but-3-en-1-yl group, which introduces a double bond into the molecule, contributing to its reactivity and potential for undergoing various chemical reactions, such as polymerization or addition reactions. The nitrile functional group (-C≡N) is known for its polar character and ability to participate in nucleophilic reactions, making this compound useful in organic synthesis and material science. Additionally, the presence of the aromatic benzene ring imparts stability and influences the compound's physical properties, such as solubility and boiling point. Overall, 4-but-3-en-1-ylbenzonitrile is of interest in the fields of organic chemistry and materials science, particularly for applications involving synthesis and functional materials.

Formula: C₁₁H₁₁N

InChI: InChI=1/C11H11N/c1-2-3-4-10-5-7-11(9-12)8-6-10/h2,5-8H,1,3-4H2

4-(4-cyanophenyl)-1-butene

CAS: 15451-33-9

• Purity: 97.0%
• Molecular weight: 157.21600341796875

4-(4-Cyanophenyl)-1-butene

CAS: 15451-33-9

Versatile small molecule scaffold

• Formula: C₁₁H₁₁N
• Purity: Min. 95%
• Molecular weight: 157.21 g/mol