CAS 15451-33-9: 4-but-3-en-1-ylbenzonitrile
Description:4-but-3-en-1-ylbenzonitrile, also known by its CAS number 15451-33-9, is an organic compound characterized by the presence of both a nitrile group and an alkenyl side chain attached to a benzene ring. The structure features a but-3-en-1-yl group, which introduces a double bond into the molecule, contributing to its reactivity and potential for undergoing various chemical reactions, such as polymerization or addition reactions. The nitrile functional group (-C≡N) is known for its polar character and ability to participate in nucleophilic reactions, making this compound useful in organic synthesis and material science. Additionally, the presence of the aromatic benzene ring imparts stability and influences the compound's physical properties, such as solubility and boiling point. Overall, 4-but-3-en-1-ylbenzonitrile is of interest in the fields of organic chemistry and materials science, particularly for applications involving synthesis and functional materials.
Formula:C11H11N
InChI:InChI=1/C11H11N/c1-2-3-4-10-5-7-11(9-12)8-6-10/h2,5-8H,1,3-4H2
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-(4-cyanophenyl)-1-butene REF: 10-F200209CAS: 15451-33-9 | 97.0% | - - - | Discontinued product |
![]() | 4-(4-Cyanophenyl)-1-butene REF: 3D-QAA45133CAS: 15451-33-9 | Min. 95% | - - - | Discontinued product |

Ref: 10-F200209
2g | Discontinued | Request information | |
5g | Discontinued | Request information |

4-(4-Cyanophenyl)-1-butene
Ref: 3D-QAA45133
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information | |
2500mg | Discontinued | Request information |