CAS 155229-76-8: (-)-3S,5R-FLUVASTATIN SODIUM SALT
Description:(-)-3S,5R-Fluvastatin sodium salt is a pharmaceutical compound primarily used as a cholesterol-lowering agent. It belongs to the class of statins, which function by inhibiting the enzyme HMG-CoA reductase, a key player in the biosynthesis of cholesterol in the liver. This compound is characterized by its chiral centers, which contribute to its specific stereochemistry, influencing its biological activity and efficacy. As a sodium salt, it is typically more soluble in water compared to its free acid form, enhancing its bioavailability. The compound exhibits a high affinity for the target enzyme, leading to a significant reduction in low-density lipoprotein (LDL) cholesterol levels in the bloodstream. Additionally, (-)-3S,5R-Fluvastatin sodium salt may possess anti-inflammatory properties and has been studied for potential benefits beyond cholesterol management, including cardiovascular protection. Its pharmacokinetics involve hepatic metabolism, and it is primarily excreted via bile. As with all medications, it is essential to consider potential side effects and interactions with other drugs when prescribing or using this compound.
Formula:C24H26FNO4
InChI:InChI=1/C24H26FNO4/c1-15(2)26-21-6-4-3-5-20(21)24(16-7-9-17(25)10-8-16)22(26)12-11-18(27)13-19(28)14-23(29)30/h3-12,15,18-19,27-28H,13-14H2,1-2H3,(H,29,30)/b12-11+/t18-,19-/m0/s1
- Synonyms:
- (3S,5R)-7-[3-(4-Fluorophenyl)-1-(1-methylethyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoic Acid Sodium Salt
- (3S,5R,6E)-7-[3-(4-fluorophenyl)-1-(propan-2-yl)-1H-indol-2-yl]-3,5-dihydroxyhept-6-enoic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 6-Heptenoic acid, 7-[3-(4-fluorophenyl)-1-(1-methylethyl)-1H-indol-2-yl]-3,5-dihydroxy-, (3S,5R,6E)- REF: IN-DA001NR5CAS: 155229-76-8 | - - - | To inquire | Thu 13 Mar 25 |
![]() | (3S,5R)-Fluvastatin REF: 3D-FF23519CAS: 155229-76-8 | Min. 95% | - - - | Discontinued product |

6-Heptenoic acid, 7-[3-(4-fluorophenyl)-1-(1-methylethyl)-1H-indol-2-yl]-3,5-dihydroxy-, (3S,5R,6E)-
Ref: IN-DA001NR5
Undefined size | To inquire |

(3S,5R)-Fluvastatin
Ref: 3D-FF23519
1mg | Discontinued | Request information | |
2mg | Discontinued | Request information | |
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information |