CAS 15540-91-7: 2-Amino-3,6-dimethylbenzoicacid

Description:2-Amino-3,6-dimethylbenzoic acid, with the CAS number 15540-91-7, is an aromatic amino acid derivative characterized by the presence of an amino group and a carboxylic acid functional group attached to a benzene ring that is further substituted with two methyl groups. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. The presence of the amino group imparts basic properties, while the carboxylic acid group contributes acidic characteristics, allowing it to participate in various chemical reactions, including esterification and amidation. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Proper handling and storage are essential, as with many organic compounds, to ensure safety and stability.

Formula:C₉H₁₁NO₂

InChI:InChI=1/C9H11NO2/c1-5-3-4-6(2)8(10)7(5)9(11)12/h3-4H,10H2,1-2H3,(H,11,12)

Synonyms:
2-Amino-3,6-Dimethylbenzoic Acid

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Benzoic acid, 2-amino-3,6-dimethyl- REF: IN-DA001NVYCAS: 15540-91-7	- - -	To inquire	Mon 10 Mar 25
2-Amino-3,6-dimethylbenzoic acid REF: 3D-QAA54091CAS: 15540-91-7	Min. 95%	To inquire	Mon 21 Apr 25
2-Amino-3,6-dimethylbenzoic acid REF: 10-F456879CAS: 15540-91-7	95.0%	- - -	Discontinued product