CAS 15569-99-0
:γ-(Methylamino)-3-pyridinebutanoic acid
Description:
γ-(Methylamino)-3-pyridinebutanoic acid, also known by its CAS number 15569-99-0, is an organic compound characterized by its pyridine and amino acid structure. This compound features a pyridine ring, which contributes to its aromatic properties, and a butanoic acid chain that includes a methylamino group. The presence of the methylamino group enhances its potential for biological activity, making it of interest in pharmaceutical research. The compound is typically a white to off-white solid and is soluble in polar solvents, which is common for amino acids and their derivatives. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its reactivity and solubility. The compound may exhibit properties such as being a potential neurotransmitter or modulator, given its structural similarities to other biologically active molecules. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C10H14N2O2
InChI:InChI=1S/C10H14N2O2/c1-11-9(4-5-10(13)14)8-3-2-6-12-7-8/h2-3,6-7,9,11H,4-5H2,1H3,(H,13,14)
InChI key:InChIKey=WERGJLUDJRKXIV-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)(NC)C=1C=CC=NC1
Synonyms:- (?à)-g-(3-Pyridyl)-g-(methylamino)butyric acid
- 3-Pyridinebutanoic acid, γ-(methylamino)-
- 3-Pyridinebutyric acid, γ-(methylamino)-
- 3-Pyridinebutyricacid, g-(methylamino)- (6CI,7CI,8CI)
- Ba 2698
- Nih 10499
- g-(3-Pyridyl)-g-(methylamino)butyric acid
- g-(Methylamino)-3-pyridinebutyricacid
- γ-(Methylamino)-3-pyridinebutanoic acid
- γ-(Methylamino)-3-pyridinebutyric acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(Methylamino)-4-(3-pyridyl)butyric Acid
CAS:Controlled Product<p>Applications 4-(Methylamino)-4-(3-pyridyl)butyric Acid (cas# 15569-99-0) is a compound useful in organic synthesis.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br></p>Formula:C10H14N2O2Color and Shape:NeatMolecular weight:194.23
