CAS 155836-29-6: (2R,3S)-2,3-Dihydro-2-(4-hydroxy-3-methoxyphenyl)-5-[(1E)-3-hydroxy-1-propen-1-yl]-7-methoxy-3-benzofuranmethanol

Description:The chemical substance known as (2R,3S)-2,3-Dihydro-2-(4-hydroxy-3-methoxyphenyl)-5-[(1E)-3-hydroxy-1-propen-1-yl]-7-methoxy-3-benzofuranmethanol, with the CAS number 155836-29-6, is a complex organic compound characterized by its multi-functional groups and stereochemistry. It features a benzofuran core, which is a fused ring system that contributes to its aromatic properties. The presence of multiple hydroxyl (-OH) and methoxy (-OCH3) groups indicates potential for hydrogen bonding and influences its solubility and reactivity. The stereochemistry, denoted by the (2R,3S) configuration, suggests specific spatial arrangements that can affect the compound's biological activity and interactions with other molecules. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structural complexity and functional groups suggest potential applications in therapeutic contexts, although specific biological activities would require further investigation through experimental studies.

Formula:C₂₀H₂₂O₆

InChI:InChI=1S/C20H22O6/c1-24-17-10-13(5-6-16(17)23)19-15(11-22)14-8-12(4-3-7-21)9-18(25-2)20(14)26-19/h3-6,8-10,15,19,21-23H,7,11H2,1-2H3/b4-3+/t15-,19+/m1/s1

InChI key:InChIKey=KUSXBOZNRPQEON-GWKPYITFSA-N

SMILES:OC1=CC=C(C=C1OC)C2OC=3C(OC)=CC(C=CCO)=CC3C2CO

Synonyms:
3-Benzofuranmethanol, 2,3-dihydro-2-(4-hydroxy-3-methoxyphenyl)-5-(3-hydroxy-1-propenyl)-7-methoxy-, [2R-[2α,3β,5(E)]]-
3-Benzofuranmethanol, 2,3-dihydro-2-(4-hydroxy-3-methoxyphenyl)-5-[(1E)-3-hydroxy-1-propen-1-yl]-7-methoxy-, (2R,3S)-
(-)-Dehydrodiconiferyl alcohol
3-Benzofuranmethanol, 2,3-dihydro-2-(4-hydroxy-3-methoxyphenyl)-5-[(1E)-3-hydroxy-1-propenyl]-7-methoxy-, (2R,3S)-
(2R,3S)-2,3-Dihydro-2-(4-hydroxy-3-methoxyphenyl)-5-[(1E)-3-hydroxy-1-propen-1-yl]-7-methoxy-3-benzofuranmethanol

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	5-O-Methylhierochin D REF: TM-TN3134CAS: 155836-29-6	98%	To inquire	Fri 28 Mar 25
	(7R,8S)-Dehydrodiconiferyl alcohol REF: 3D-FD165776CAS: 155836-29-6	Min. 95%	- - -	Discontinued product