CAS 1559064-16-2: 3-Bromo-1-(methoxymethyl)-1H-1,2,4-triazole

Description: 3-Bromo-1-(methoxymethyl)-1H-1,2,4-triazole is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. The presence of a bromine atom at the 3-position and a methoxymethyl group at the 1-position contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound is likely to exhibit properties typical of triazoles, such as antifungal and antimicrobial activities, due to the electron-withdrawing nature of the bromine substituent and the potential for hydrogen bonding from the methoxymethyl group. Its solubility and stability can be influenced by the functional groups present, making it suitable for various synthetic pathways. Additionally, the specific arrangement of atoms and functional groups can lead to interesting interactions with biological targets, which may be explored in drug development. Overall, 3-Bromo-1-(methoxymethyl)-1H-1,2,4-triazole represents a versatile structure with potential utility in chemical synthesis and biological applications.

Formula: C₄H₆BrN₃O

InChI: InChI=1S/C4H6BrN3O/c1-9-3-8-2-6-4(5)7-8/h2H,3H2,1H3

InChI key: InChIKey=RPYUUYSGDWKQPH-UHFFFAOYSA-N

SMILES: BrC=1N=CN(N1)COC

Synonyms:

• 1H-1,2,4-Triazole, 3-bromo-1-(methoxymethyl)-
• 3-Bromo-1-(methoxymethyl)-1H-1,2,4-triazole

3-bromo-1-(methoxymethyl)-1H-1,2,4-triazole

CAS: 1559064-16-2

• Purity: 95.0%
• Molecular weight: 192.01600646972656

3-Bromo-1-(methoxymethyl)-1H-1,2,4-triazole

CAS: 1559064-16-2

Please enquire for more information about 3-Bromo-1-(methoxymethyl)-1H-1,2,4-triazole including the price, delivery time and more detailed …

• Formula: C₄H₆BrN₃O
• Purity: Min. 95%
• Molecular weight: 192.01 g/mol