CAS 156469-00-0: (αR)-α-Hydroxycyclohexanepropanoic acid
Description:(αR)-α-Hydroxycyclohexanepropanoic acid, with the CAS number 156469-00-0, is an organic compound characterized by its unique structure that includes a cyclohexane ring and a hydroxyl group adjacent to a propanoic acid moiety. This compound is a chiral molecule, meaning it has non-superimposable mirror images, which can lead to different biological activities depending on the specific enantiomer. It is typically a white to off-white solid at room temperature and is soluble in polar solvents due to the presence of the hydroxyl and carboxylic acid functional groups. The compound may exhibit properties such as being a potential intermediate in organic synthesis or having applications in pharmaceuticals, particularly in the development of drugs that target specific biological pathways. Its stereochemistry plays a crucial role in its reactivity and interactions with biological systems, making it of interest in medicinal chemistry and related fields. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper use and minimize risks.
Formula:C9H16O3
InChI:InChI=1S/C9H16O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h7-8,10H,1-6H2,(H,11,12)/t8-/m1/s1
InChI key:InChIKey=WMHUKKRNWMPXKB-MRVPVSSYSA-N
SMILES:O=C(O)C(O)CC1CCCCC1
- Synonyms:
- (2R)-3-Cyclohexyl-2-hydroxypropanoic acid
- Cyclohexanepropanoic acid, α-hydroxy-, (R)-
- Cyclohexanepropanoic acid, α-hydroxy-, (αR)-
- (αR)-α-Hydroxycyclohexanepropanoic acid

(R)-a-Hydroxy-cyclohexanepropanoic acid
Ref: IN-DA01JMBV
1g | 105.00 € | ||
5g | 267.00 € | ||
10g | 602.00 € | ||
25g | To inquire | ||
100g | To inquire | ||
500mg | 77.00 € |

Ref: 10-F606348
1g | To inquire | ||
5g | To inquire | ||
10g | To inquire | ||
25g | To inquire | ||
100g | To inquire | ||
500mg | To inquire |

(R)-α-hydroxy-cyclohexanepropanoic acid
Ref: 3D-GGA46900
1g | 450.00 € | ||
10g | 1,608.00 € |