CAS 156682-53-0: 3-Bromo-2-fluoro-phenol
Description:3-Bromo-2-fluoro-phenol is an organic compound characterized by the presence of both bromine and fluorine substituents on a phenolic ring. The bromine atom is located at the meta position (3-position), while the fluorine atom is at the ortho position (2-position) relative to the hydroxyl (-OH) group. This compound exhibits typical phenolic properties, including moderate acidity due to the hydroxyl group, which can participate in hydrogen bonding. The presence of halogens, such as bromine and fluorine, can significantly influence the compound's reactivity, polarity, and solubility in various solvents. 3-Bromo-2-fluoro-phenol may be used in various chemical syntheses and applications, including pharmaceuticals and agrochemicals, due to its unique electronic and steric properties. Additionally, the compound's structure suggests potential for further functionalization, making it a valuable intermediate in organic synthesis. Safety precautions should be observed when handling this compound, as halogenated phenols can pose health risks and environmental concerns.
Formula:C6H4BrFO
InChI:InChI=1/C6H4BrFO/c7-4-2-1-3-5(9)6(4)8/h1-3,9H
- Synonyms:
- 3-Bromo-2-fluorophenol
- Phenol, 3-bromo-2-fluoro-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-Bromo-2-fluorophenol REF: 10-F046496CAS: 156682-53-0 | 98.0% | 32.00 €~628.00 € | Tue 01 Apr 25 |
![]() | 3-Bromo-2-fluorophenol REF: 54-PC1687CAS: 156682-53-0 | 97% | 97.00 €~1,018.00 € | Thu 03 Apr 25 |
![]() | 3-Bromo-2-fluoro-phenol REF: 3D-FB105196CAS: 156682-53-0 | Min. 95% | - - - | Discontinued product |

3-Bromo-2-fluorophenol
Ref: 10-F046496
1g | 32.00 € | ||
5g | 56.00 € | ||
10g | 96.00 € | ||
25g | 175.00 € | ||
100g | 628.00 € |

3-Bromo-2-fluorophenol
Ref: 54-PC1687
1g | 97.00 € | ||
5g | 248.00 € | ||
25g | 862.00 € |

3-Bromo-2-fluoro-phenol
Ref: 3D-FB105196
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |