CAS 157-06-2: D-(-)-Arginine
Description:D-(-)-Arginine, with the CAS number 157-06-2, is an amino acid that is a chiral form of arginine, an essential building block of proteins. It is characterized by its basic nature due to the presence of a guanidinium group in its side chain, which contributes to its positive charge at physiological pH. This amino acid plays a crucial role in various biological processes, including protein synthesis, the urea cycle, and the production of nitric oxide, a signaling molecule involved in vasodilation. D-(-)-Arginine is less common than its L-form but is of interest in research and therapeutic applications, particularly in studies related to cardiovascular health and metabolic disorders. It is typically found in crystalline form and is soluble in water, making it suitable for various biochemical applications. Additionally, D-(-)-Arginine can be utilized in the synthesis of peptides and as a potential supplement in sports nutrition, although its effects and efficacy may vary.
Formula:C6H14N4O2
InChI:InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m1/s1
InChI key:InChIKey=ODKSFYDXXFIFQN-SCSAIBSYSA-N
SMILES:O=C(O)C(N)CCCNC(=N)N
- Synonyms:
- (2R)-2-Amino-5-(diaminomethylideneamino)pentanoic acid
- (2R)-2-Amino-5-[(diaminomethylidene)amino]pentanoic acid
- (2R)-2-Amino-5-carbamimidamidopentanoic acid
- (R)-2-Amino-5-guanidinopentanoic acid
- (R)-Arginine
- <span class="text-smallcaps">D</span>-Arginine
- Arginine, <span class="text-smallcaps">D</span>-
- D-2-Amino-5-guanidinopentanoic acid
- H-D-Arg-OH
- H-D-Arginine
- See more synonyms
- Arginine, D-
- D-Arginine
- D-Arginine
- D(-)-arginine
