CAS 157402-44-3: 6-(4-fluorophenyl)pyridine-2-carbaldehyde

Description:6-(4-Fluorophenyl)pyridine-2-carbaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the para position of a phenyl ring, which is attached to the pyridine at the 6-position. The compound also features an aldehyde functional group (-CHO) at the 2-position of the pyridine ring, contributing to its reactivity and potential applications in organic synthesis. This structure imparts unique electronic properties and influences its solubility and interaction with other chemical species. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis typically involves reactions that form carbon-nitrogen bonds and may require specific conditions to ensure the stability of the aldehyde group. Overall, 6-(4-fluorophenyl)pyridine-2-carbaldehyde is a versatile building block in the synthesis of more complex organic molecules.

Formula:C₁₂H₉NO

InChI:InChI=1/C12H9NO/c14-9-11-7-4-8-12(13-11)10-5-2-1-3-6-10/h1-9H

Synonyms:
6-Phenylpyridine-2-carboxaldehyde
6-Phenylpyridine-2-Carbaldehyde

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-Pyridinecarboxaldehyde, 6-phenyl- REF: IN-DA001PFNCAS: 157402-44-3	95%	To inquire	Tue 11 Mar 25
6-Phenylpicolinaldehyde REF: 54-OR73834CAS: 157402-44-3	95%	269.00 €~1,559.00 €	Wed 12 Mar 25
6-Phenylpicolinaldehyde REF: 10-F238478CAS: 157402-44-3	95.0%	72.00 €~849.00 €	Fri 14 Mar 25
6-(4-Fluorophenyl)-2-Pyridinecarbaldehyde REF: 3D-FF86395CAS: 157402-44-3	Min. 95%	- - -	Discontinued product