CAS 157444-53-6: 5-o-carboranyl-1-(2-deoxy-2-fluoro-arabinofuranosyl)uracil
Description:5-o-Carboranyl-1-(2-deoxy-2-fluoro-arabinofuranosyl)uracil is a synthetic nucleoside analog that incorporates a carborane moiety, which is a cluster of carbon and boron atoms. This compound is characterized by its unique structural features, including the presence of a fluorine atom on the sugar moiety, which enhances its stability and potential bioactivity. The uracil base contributes to its nucleoside properties, allowing it to interact with nucleic acid synthesis pathways. The carborane component is known for its high thermal stability and potential applications in medicinal chemistry, particularly in targeting cancer cells due to its ability to penetrate biological membranes. The compound may exhibit antiviral or anticancer properties, making it of interest in pharmaceutical research. Its specific interactions and mechanisms of action would require further investigation through biological assays and studies to fully elucidate its therapeutic potential. Overall, this compound represents a fascinating intersection of organic chemistry and medicinal applications, highlighting the innovative approaches in drug design.
Formula:C11H10B10FN2O5
InChI:InChI=1/C11H10B10FN2O5/c22-5-6(26)4(2-25)29-8(5)24-1-3(7(27)23-9(24)28)10-11-13(10)15(11)18(14(10)11)16-12-17-20-19(16)21(17)20/h1,4-6,8,25-26H,2H2,(H,23,27,28)/t4-,5+,6-,8-,10?,11?/m1/s1
- Synonyms:
- 1-(2-Deoxy-2-fluoro-beta-D-ribofuranosyl)-5-(1,2-dicarbadodecaboran(12)-1-yl)-2,4(1H,3H)-pyrimidinedione
- 5-Cfau
- 5-o-Carboranyl-1-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)uracil
- 2,4(1H,3H)-Pyrimidinedione, 1-(2-deoxy-2-fluoro-beta-D-ribofuranosyl)-5-(1,2-dicarbadodecaboran(12)-1-yl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5-O-Carboranyl-1-(2-Deoxy-2-Fluoro-β-D-Arabinofuranosyl)Uracil REF: 3D-FC97813CAS: 157444-53-6 | Min. 95% | - - - | Discontinued product |

5-O-Carboranyl-1-(2-Deoxy-2-Fluoro-β-D-Arabinofuranosyl)Uracil
Ref: 3D-FC97813
Undefined size | Discontinued | Request information |