CAS 15763-06-1: 1-Methyladenosine
Description:1-Methyladenosine is a naturally occurring nucleoside derivative of adenosine, characterized by the presence of a methyl group attached to the nitrogen atom at the first position of the adenine base. This modification plays a crucial role in various biological processes, particularly in RNA metabolism and regulation. It is involved in the post-transcriptional modification of RNA, influencing RNA stability, splicing, and translation. The presence of the methyl group can affect the interaction of RNA with proteins and other molecules, thereby impacting gene expression and cellular function. 1-Methyladenosine is also a component of certain tRNA molecules, contributing to their proper functioning during protein synthesis. In terms of solubility, it is generally soluble in water and polar solvents, which is typical for nucleosides. Its chemical structure includes a ribose sugar linked to the modified adenine base, and it can be analyzed using various techniques such as chromatography and mass spectrometry. Overall, 1-methyladenosine is significant in the field of molecular biology and biochemistry due to its regulatory roles in cellular processes.
Formula:C11H15N5O4
InChI:InChI=1S/C11H15N5O4/c1-15-3-14-10-6(9(15)12)13-4-16(10)11-8(19)7(18)5(2-17)20-11/h3-5,7-8,11-12,17-19H,2H2,1H3/t5-,7-,8-,11-/m1/s1
InChI key:InChIKey=GFYLSDSUCHVORB-IOSLPCCCSA-N
SMILES:N=C1C=2N=CN(C2N=CN1C)C3OC(CO)C(O)C3O
- Synonyms:
- (6Z)-1-methyl-9-pentofuranosyl-1,9-dihydro-6H-purin-6-imine
- 1-Methyladenosine
- 9H-Purine, 1,6-dihydro-6-imino-1-methyl-9-β-<span class="text-smallcaps">D</span>-ribofuranosyl-
- Adenosine, 1-methyl-
- Adenosine, 1-methyl- (VAN) (8CI)
- Adenosine, N,6-didehydro-1,6-dihydro-1-methyl- (9CI)
- N1-Methyladenosine
- N<sup>1</sup>-Methyladenosine
- Nsc 92165
- 9H-Purine, 1,6-dihydro-6-imino-1-methyl-9-β-D-ribofuranosyl-
- See more synonyms
