CAS 157671-68-6: Methylsulfonyl nitro peroxide

Description:Methylsulfonyl nitro peroxide, identified by its CAS number 157671-68-6, is a chemical compound characterized by its unique structure that includes a methylsulfonyl group and a nitro peroxide moiety. This compound is typically recognized for its potential applications in the field of energetic materials due to its oxidizing properties. It is a relatively unstable substance, which can pose safety risks, particularly in terms of sensitivity to heat, shock, and friction. The presence of both the nitro and peroxide functional groups suggests that it may exhibit explosive characteristics under certain conditions. Additionally, methylsulfonyl nitro peroxide may have specific solubility properties, often being soluble in organic solvents while exhibiting limited solubility in water. Handling this compound requires strict adherence to safety protocols to mitigate risks associated with its reactivity and potential hazards. Overall, its unique chemical structure and properties make it a subject of interest in both research and industrial applications, particularly in the development of new energetic materials.

Formula:CH₃NO₆S

InChI:InChI=1S/CH3NO6S/c1-9(5,6)8-7-2(3)4/h1H3

InChI key:InChIKey=IMLJWBRSRKRPAQ-UHFFFAOYSA-N

SMILES:O=N(=O)OOS(=O)(=O)C